Logo Search packages:      
Sourcecode: linux-fsl-imx51 version File versions  Download package

matroxfb_base.c

/*
 *
 * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400
 *
 * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
 *
 * Portions Copyright (c) 2001 Matrox Graphics Inc.
 *
 * Version: 1.65 2002/08/14
 *
 * MTRR stuff: 1998 Tom Rini <trini@kernel.crashing.org>
 *
 * Contributors: "menion?" <menion@mindless.com>
 *                     Betatesting, fixes, ideas
 *
 *               "Kurt Garloff" <garloff@suse.de>
 *                     Betatesting, fixes, ideas, videomodes, videomodes timmings
 *
 *               "Tom Rini" <trini@kernel.crashing.org>
 *                     MTRR stuff, PPC cleanups, betatesting, fixes, ideas
 *
 *               "Bibek Sahu" <scorpio@dodds.net>
 *                     Access device through readb|w|l and write b|w|l
 *                     Extensive debugging stuff
 *
 *               "Daniel Haun" <haund@usa.net>
 *                     Testing, hardware cursor fixes
 *
 *               "Scott Wood" <sawst46+@pitt.edu>
 *                     Fixes
 *
 *               "Gerd Knorr" <kraxel@goldbach.isdn.cs.tu-berlin.de>
 *                     Betatesting
 *
 *               "Kelly French" <targon@hazmat.com>
 *               "Fernando Herrera" <fherrera@eurielec.etsit.upm.es>
 *                     Betatesting, bug reporting
 *
 *               "Pablo Bianucci" <pbian@pccp.com.ar>
 *                     Fixes, ideas, betatesting
 *
 *               "Inaky Perez Gonzalez" <inaky@peloncho.fis.ucm.es>
 *                     Fixes, enhandcements, ideas, betatesting
 *
 *               "Ryuichi Oikawa" <roikawa@rr.iiij4u.or.jp>
 *                     PPC betatesting, PPC support, backward compatibility
 *
 *               "Paul Womar" <Paul@pwomar.demon.co.uk>
 *               "Owen Waller" <O.Waller@ee.qub.ac.uk>
 *                     PPC betatesting
 *
 *               "Thomas Pornin" <pornin@bolet.ens.fr>
 *                     Alpha betatesting
 *
 *               "Pieter van Leuven" <pvl@iae.nl>
 *               "Ulf Jaenicke-Roessler" <ujr@physik.phy.tu-dresden.de>
 *                     G100 testing
 *
 *               "H. Peter Arvin" <hpa@transmeta.com>
 *                     Ideas
 *
 *               "Cort Dougan" <cort@cs.nmt.edu>
 *                     CHRP fixes and PReP cleanup
 *
 *               "Mark Vojkovich" <mvojkovi@ucsd.edu>
 *                     G400 support
 *
 *               "Samuel Hocevar" <sam@via.ecp.fr>
 *                     Fixes
 *
 *               "Anton Altaparmakov" <AntonA@bigfoot.com>
 *                     G400 MAX/non-MAX distinction
 *
 *               "Ken Aaker" <kdaaker@rchland.vnet.ibm.com>
 *                     memtype extension (needed for GXT130P RS/6000 adapter)
 *
 *               "Uns Lider" <unslider@miranda.org>
 *                     G100 PLNWT fixes
 *
 *               "Denis Zaitsev" <zzz@cd-club.ru>
 *                     Fixes
 *
 *               "Mike Pieper" <mike@pieper-family.de>
 *                     TVOut enhandcements, V4L2 control interface.
 *
 *               "Diego Biurrun" <diego@biurrun.de>
 *                     DFP testing
 *
 * (following author is not in any relation with this code, but his code
 *  is included in this driver)
 *
 * Based on framebuffer driver for VBE 2.0 compliant graphic boards
 *     (c) 1998 Gerd Knorr <kraxel@cs.tu-berlin.de>
 *
 * (following author is not in any relation with this code, but his ideas
 *  were used when writing this driver)
 *
 *           FreeVBE/AF (Matrox), "Shawn Hargreaves" <shawn@talula.demon.co.uk>
 *
 */

#include <linux/version.h>

#define __OLD_VIDIOC_

#include "matroxfb_base.h"
#include "matroxfb_misc.h"
#include "matroxfb_accel.h"
#include "matroxfb_DAC1064.h"
#include "matroxfb_Ti3026.h"
#include "matroxfb_maven.h"
#include "matroxfb_crtc2.h"
#include "matroxfb_g450.h"
#include <linux/matroxfb.h>
#include <linux/interrupt.h>
#include <linux/uaccess.h>

#ifdef CONFIG_PPC_PMAC
#include <asm/machdep.h>
unsigned char nvram_read_byte(int);
static int default_vmode = VMODE_NVRAM;
static int default_cmode = CMODE_NVRAM;
#endif

static void matroxfb_unregister_device(struct matrox_fb_info* minfo);

/* --------------------------------------------------------------------- */

/*
 * card parameters
 */

/* --------------------------------------------------------------------- */

static struct fb_var_screeninfo vesafb_defined = {
      640,480,640,480,/* W,H, W, H (virtual) load xres,xres_virtual*/
      0,0,        /* virtual -> visible no offset */
      8,          /* depth -> load bits_per_pixel */
      0,          /* greyscale ? */
      {0,0,0},    /* R */
      {0,0,0},    /* G */
      {0,0,0},    /* B */
      {0,0,0},    /* transparency */
      0,          /* standard pixel format */
      FB_ACTIVATE_NOW,
      -1,-1,
      FB_ACCELF_TEXT,   /* accel flags */
      39721L,48L,16L,33L,10L,
      96L,2L,~0,  /* No sync info */
      FB_VMODE_NONINTERLACED,
      0, {0,0,0,0,0}
};



/* --------------------------------------------------------------------- */
static void update_crtc2(WPMINFO unsigned int pos) {
      struct matroxfb_dh_fb_info* info = ACCESS_FBINFO(crtc2.info);

      /* Make sure that displays are compatible */
      if (info && (info->fbcon.var.bits_per_pixel == ACCESS_FBINFO(fbcon).var.bits_per_pixel)
             && (info->fbcon.var.xres_virtual == ACCESS_FBINFO(fbcon).var.xres_virtual)
             && (info->fbcon.var.green.length == ACCESS_FBINFO(fbcon).var.green.length)
             ) {
            switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
                  case 16:
                  case 32:
                        pos = pos * 8;
                        if (info->interlaced) {
                              mga_outl(0x3C2C, pos);
                              mga_outl(0x3C28, pos + ACCESS_FBINFO(fbcon).var.xres_virtual * ACCESS_FBINFO(fbcon).var.bits_per_pixel / 8);
                        } else {
                              mga_outl(0x3C28, pos);
                        }
                        break;
            }
      }
}

static void matroxfb_crtc1_panpos(WPMINFO2) {
      if (ACCESS_FBINFO(crtc1.panpos) >= 0) {
            unsigned long flags;
            int panpos;

            matroxfb_DAC_lock_irqsave(flags);
            panpos = ACCESS_FBINFO(crtc1.panpos);
            if (panpos >= 0) {
                  unsigned int extvga_reg;

                  ACCESS_FBINFO(crtc1.panpos) = -1; /* No update pending anymore */
                  extvga_reg = mga_inb(M_EXTVGA_INDEX);
                  mga_setr(M_EXTVGA_INDEX, 0x00, panpos);
                  if (extvga_reg != 0x00) {
                        mga_outb(M_EXTVGA_INDEX, extvga_reg);
                  }
            }
            matroxfb_DAC_unlock_irqrestore(flags);
      }
}

static irqreturn_t matrox_irq(int irq, void *dev_id)
{
      u_int32_t status;
      int handled = 0;

      MINFO_FROM(dev_id);

      status = mga_inl(M_STATUS);

      if (status & 0x20) {
            mga_outl(M_ICLEAR, 0x20);
            ACCESS_FBINFO(crtc1.vsync.cnt)++;
            matroxfb_crtc1_panpos(PMINFO2);
            wake_up_interruptible(&ACCESS_FBINFO(crtc1.vsync.wait));
            handled = 1;
      }
      if (status & 0x200) {
            mga_outl(M_ICLEAR, 0x200);
            ACCESS_FBINFO(crtc2.vsync.cnt)++;
            wake_up_interruptible(&ACCESS_FBINFO(crtc2.vsync.wait));
            handled = 1;
      }
      return IRQ_RETVAL(handled);
}

int matroxfb_enable_irq(WPMINFO int reenable) {
      u_int32_t bm;

      if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
            bm = 0x220;
      else
            bm = 0x020;

      if (!test_and_set_bit(0, &ACCESS_FBINFO(irq_flags))) {
            if (request_irq(ACCESS_FBINFO(pcidev)->irq, matrox_irq,
                        IRQF_SHARED, "matroxfb", MINFO)) {
                  clear_bit(0, &ACCESS_FBINFO(irq_flags));
                  return -EINVAL;
            }
            /* Clear any pending field interrupts */
            mga_outl(M_ICLEAR, bm);
            mga_outl(M_IEN, mga_inl(M_IEN) | bm);
      } else if (reenable) {
            u_int32_t ien;

            ien = mga_inl(M_IEN);
            if ((ien & bm) != bm) {
                  printk(KERN_DEBUG "matroxfb: someone disabled IRQ [%08X]\n", ien);
                  mga_outl(M_IEN, ien | bm);
            }
      }
      return 0;
}

static void matroxfb_disable_irq(WPMINFO2) {
      if (test_and_clear_bit(0, &ACCESS_FBINFO(irq_flags))) {
            /* Flush pending pan-at-vbl request... */
            matroxfb_crtc1_panpos(PMINFO2);
            if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
                  mga_outl(M_IEN, mga_inl(M_IEN) & ~0x220);
            else
                  mga_outl(M_IEN, mga_inl(M_IEN) & ~0x20);
            free_irq(ACCESS_FBINFO(pcidev)->irq, MINFO);
      }
}

int matroxfb_wait_for_sync(WPMINFO u_int32_t crtc) {
      struct matrox_vsync *vs;
      unsigned int cnt;
      int ret;

      switch (crtc) {
            case 0:
                  vs = &ACCESS_FBINFO(crtc1.vsync);
                  break;
            case 1:
                  if (ACCESS_FBINFO(devflags.accelerator) != FB_ACCEL_MATROX_MGAG400) {
                        return -ENODEV;
                  }
                  vs = &ACCESS_FBINFO(crtc2.vsync);
                  break;
            default:
                  return -ENODEV;
      }
      ret = matroxfb_enable_irq(PMINFO 0);
      if (ret) {
            return ret;
      }

      cnt = vs->cnt;
      ret = wait_event_interruptible_timeout(vs->wait, cnt != vs->cnt, HZ/10);
      if (ret < 0) {
            return ret;
      }
      if (ret == 0) {
            matroxfb_enable_irq(PMINFO 1);
            return -ETIMEDOUT;
      }
      return 0;
}

/* --------------------------------------------------------------------- */

static void matrox_pan_var(WPMINFO struct fb_var_screeninfo *var) {
      unsigned int pos;
      unsigned short p0, p1, p2;
#ifdef CONFIG_FB_MATROX_32MB
      unsigned int p3;
#endif
      int vbl;
      unsigned long flags;

      CRITFLAGS

      DBG(__func__)

      if (ACCESS_FBINFO(dead))
            return;

      ACCESS_FBINFO(fbcon).var.xoffset = var->xoffset;
      ACCESS_FBINFO(fbcon).var.yoffset = var->yoffset;
      pos = (ACCESS_FBINFO(fbcon).var.yoffset * ACCESS_FBINFO(fbcon).var.xres_virtual + ACCESS_FBINFO(fbcon).var.xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32;
      pos += ACCESS_FBINFO(curr.ydstorg.chunks);
      p0 = ACCESS_FBINFO(hw).CRTC[0x0D] = pos & 0xFF;
      p1 = ACCESS_FBINFO(hw).CRTC[0x0C] = (pos & 0xFF00) >> 8;
      p2 = ACCESS_FBINFO(hw).CRTCEXT[0] = (ACCESS_FBINFO(hw).CRTCEXT[0] & 0xB0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
#ifdef CONFIG_FB_MATROX_32MB
      p3 = ACCESS_FBINFO(hw).CRTCEXT[8] = pos >> 21;
#endif

      /* FB_ACTIVATE_VBL and we can acquire interrupts? Honor FB_ACTIVATE_VBL then... */
      vbl = (var->activate & FB_ACTIVATE_VBL) && (matroxfb_enable_irq(PMINFO 0) == 0);

      CRITBEGIN

      matroxfb_DAC_lock_irqsave(flags);
      mga_setr(M_CRTC_INDEX, 0x0D, p0);
      mga_setr(M_CRTC_INDEX, 0x0C, p1);
#ifdef CONFIG_FB_MATROX_32MB
      if (ACCESS_FBINFO(devflags.support32MB))
            mga_setr(M_EXTVGA_INDEX, 0x08, p3);
#endif
      if (vbl) {
            ACCESS_FBINFO(crtc1.panpos) = p2;
      } else {
            /* Abort any pending change */
            ACCESS_FBINFO(crtc1.panpos) = -1;
            mga_setr(M_EXTVGA_INDEX, 0x00, p2);
      }
      matroxfb_DAC_unlock_irqrestore(flags);

      update_crtc2(PMINFO pos);

      CRITEND
}

static void matroxfb_remove(WPMINFO int dummy) {
      /* Currently we are holding big kernel lock on all dead & usecount updates.
       * Destroy everything after all users release it. Especially do not unregister
       * framebuffer and iounmap memory, neither fbmem nor fbcon-cfb* does not check
       * for device unplugged when in use.
       * In future we should point mmio.vbase & video.vbase somewhere where we can
       * write data without causing too much damage...
       */

      ACCESS_FBINFO(dead) = 1;
      if (ACCESS_FBINFO(usecount)) {
            /* destroy it later */
            return;
      }
      matroxfb_unregister_device(MINFO);
      unregister_framebuffer(&ACCESS_FBINFO(fbcon));
      matroxfb_g450_shutdown(PMINFO2);
#ifdef CONFIG_MTRR
      if (ACCESS_FBINFO(mtrr.vram_valid))
            mtrr_del(ACCESS_FBINFO(mtrr.vram), ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len));
#endif
      mga_iounmap(ACCESS_FBINFO(mmio.vbase));
      mga_iounmap(ACCESS_FBINFO(video.vbase));
      release_mem_region(ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len_maximum));
      release_mem_region(ACCESS_FBINFO(mmio.base), 16384);
#ifdef CONFIG_FB_MATROX_MULTIHEAD
      kfree(minfo);
#endif
}

      /*
       * Open/Release the frame buffer device
       */

static int matroxfb_open(struct fb_info *info, int user)
{
      MINFO_FROM_INFO(info);

      DBG_LOOP(__func__)

      if (ACCESS_FBINFO(dead)) {
            return -ENXIO;
      }
      ACCESS_FBINFO(usecount)++;
      if (user) {
            ACCESS_FBINFO(userusecount)++;
      }
      return(0);
}

static int matroxfb_release(struct fb_info *info, int user)
{
      MINFO_FROM_INFO(info);

      DBG_LOOP(__func__)

      if (user) {
            if (0 == --ACCESS_FBINFO(userusecount)) {
                  matroxfb_disable_irq(PMINFO2);
            }
      }
      if (!(--ACCESS_FBINFO(usecount)) && ACCESS_FBINFO(dead)) {
            matroxfb_remove(PMINFO 0);
      }
      return(0);
}

static int matroxfb_pan_display(struct fb_var_screeninfo *var,
            struct fb_info* info) {
      MINFO_FROM_INFO(info);

      DBG(__func__)

      matrox_pan_var(PMINFO var);
      return 0;
}

static int matroxfb_get_final_bppShift(CPMINFO int bpp) {
      int bppshft2;

      DBG(__func__)

      bppshft2 = bpp;
      if (!bppshft2) {
            return 8;
      }
      if (isInterleave(MINFO))
            bppshft2 >>= 1;
      if (ACCESS_FBINFO(devflags.video64bits))
            bppshft2 >>= 1;
      return bppshft2;
}

static int matroxfb_test_and_set_rounding(CPMINFO int xres, int bpp) {
      int over;
      int rounding;

      DBG(__func__)

      switch (bpp) {
            case 0:           return xres;
            case 4:           rounding = 128;
                        break;
            case 8:           rounding = 64;    /* doc says 64; 32 is OK for G400 */
                        break;
            case 16:    rounding = 32;
                        break;
            case 24:    rounding = 64;    /* doc says 64; 32 is OK for G400 */
                        break;
            default:    rounding = 16;
                        /* on G400, 16 really does not work */
                        if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
                              rounding = 32;
                        break;
      }
      if (isInterleave(MINFO)) {
            rounding *= 2;
      }
      over = xres % rounding;
      if (over)
            xres += rounding-over;
      return xres;
}

static int matroxfb_pitch_adjust(CPMINFO int xres, int bpp) {
      const int* width;
      int xres_new;

      DBG(__func__)

      if (!bpp) return xres;

      width = ACCESS_FBINFO(capable.vxres);

      if (ACCESS_FBINFO(devflags.precise_width)) {
            while (*width) {
                  if ((*width >= xres) && (matroxfb_test_and_set_rounding(PMINFO *width, bpp) == *width)) {
                        break;
                  }
                  width++;
            }
            xres_new = *width;
      } else {
            xres_new = matroxfb_test_and_set_rounding(PMINFO xres, bpp);
      }
      return xres_new;
}

static int matroxfb_get_cmap_len(struct fb_var_screeninfo *var) {

      DBG(__func__)

      switch (var->bits_per_pixel) {
            case 4:
                  return 16;  /* pseudocolor... 16 entries HW palette */
            case 8:
                  return 256; /* pseudocolor... 256 entries HW palette */
            case 16:
                  return 16;  /* directcolor... 16 entries SW palette */
                              /* Mystique: truecolor, 16 entries SW palette, HW palette hardwired into 1:1 mapping */
            case 24:
                  return 16;  /* directcolor... 16 entries SW palette */
                              /* Mystique: truecolor, 16 entries SW palette, HW palette hardwired into 1:1 mapping */
            case 32:
                  return 16;  /* directcolor... 16 entries SW palette */
                              /* Mystique: truecolor, 16 entries SW palette, HW palette hardwired into 1:1 mapping */
      }
      return 16;  /* return something reasonable... or panic()? */
}

static int matroxfb_decode_var(CPMINFO struct fb_var_screeninfo *var, int *visual, int *video_cmap_len, unsigned int* ydstorg) {
      struct RGBT {
            unsigned char bpp;
            struct {
                  unsigned char offset,
                              length;
            } red,
              green,
              blue,
              transp;
            signed char visual;
      };
      static const struct RGBT table[]= {
            { 8,{ 0,8},{0,8},{0,8},{ 0,0},MX_VISUAL_PSEUDOCOLOR},
            {15,{10,5},{5,5},{0,5},{15,1},MX_VISUAL_DIRECTCOLOR},
            {16,{11,5},{5,6},{0,5},{ 0,0},MX_VISUAL_DIRECTCOLOR},
            {24,{16,8},{8,8},{0,8},{ 0,0},MX_VISUAL_DIRECTCOLOR},
            {32,{16,8},{8,8},{0,8},{24,8},MX_VISUAL_DIRECTCOLOR}
      };
      struct RGBT const *rgbt;
      unsigned int bpp = var->bits_per_pixel;
      unsigned int vramlen;
      unsigned int memlen;

      DBG(__func__)

      switch (bpp) {
            case 4:      if (!ACCESS_FBINFO(capable.cfb4)) return -EINVAL;
                   break;
            case 8:      break;
            case 16: break;
            case 24: break;
            case 32: break;
            default: return -EINVAL;
      }
      *ydstorg = 0;
      vramlen = ACCESS_FBINFO(video.len_usable);
      if (var->yres_virtual < var->yres)
            var->yres_virtual = var->yres;
      if (var->xres_virtual < var->xres)
            var->xres_virtual = var->xres;

      var->xres_virtual = matroxfb_pitch_adjust(PMINFO var->xres_virtual, bpp);
      memlen = var->xres_virtual * bpp * var->yres_virtual / 8;
      if (memlen > vramlen) {
            var->yres_virtual = vramlen * 8 / (var->xres_virtual * bpp);
            memlen = var->xres_virtual * bpp * var->yres_virtual / 8;
      }
      /* There is hardware bug that no line can cross 4MB boundary */
      /* give up for CFB24, it is impossible to easy workaround it */
      /* for other try to do something */
      if (!ACCESS_FBINFO(capable.cross4MB) && (memlen > 0x400000)) {
            if (bpp == 24) {
                  /* sorry */
            } else {
                  unsigned int linelen;
                  unsigned int m1 = linelen = var->xres_virtual * bpp / 8;
                  unsigned int m2 = PAGE_SIZE;  /* or 128 if you do not need PAGE ALIGNED address */
                  unsigned int max_yres;

                  while (m1) {
                        int t;

                        while (m2 >= m1) m2 -= m1;
                        t = m1;
                        m1 = m2;
                        m2 = t;
                  }
                  m2 = linelen * PAGE_SIZE / m2;
                  *ydstorg = m2 = 0x400000 % m2;
                  max_yres = (vramlen - m2) / linelen;
                  if (var->yres_virtual > max_yres)
                        var->yres_virtual = max_yres;
            }
      }
      /* YDSTLEN contains only signed 16bit value */
      if (var->yres_virtual > 32767)
            var->yres_virtual = 32767;
      /* we must round yres/xres down, we already rounded y/xres_virtual up
         if it was possible. We should return -EINVAL, but I disagree */
      if (var->yres_virtual < var->yres)
            var->yres = var->yres_virtual;
      if (var->xres_virtual < var->xres)
            var->xres = var->xres_virtual;
      if (var->xoffset + var->xres > var->xres_virtual)
            var->xoffset = var->xres_virtual - var->xres;
      if (var->yoffset + var->yres > var->yres_virtual)
            var->yoffset = var->yres_virtual - var->yres;

      if (bpp == 16 && var->green.length == 5) {
            bpp--; /* an artifical value - 15 */
      }

      for (rgbt = table; rgbt->bpp < bpp; rgbt++);
#define     SETCLR(clr)\
      var->clr.offset = rgbt->clr.offset;\
      var->clr.length = rgbt->clr.length
      SETCLR(red);
      SETCLR(green);
      SETCLR(blue);
      SETCLR(transp);
#undef      SETCLR
      *visual = rgbt->visual;

      if (bpp > 8)
            dprintk("matroxfb: truecolor: "
                  "size=%d:%d:%d:%d, shift=%d:%d:%d:%d\n",
                  var->transp.length, var->red.length, var->green.length, var->blue.length,
                  var->transp.offset, var->red.offset, var->green.offset, var->blue.offset);

      *video_cmap_len = matroxfb_get_cmap_len(var);
      dprintk(KERN_INFO "requested %d*%d/%dbpp (%d*%d)\n", var->xres, var->yres, var->bits_per_pixel,
                        var->xres_virtual, var->yres_virtual);
      return 0;
}

static int matroxfb_setcolreg(unsigned regno, unsigned red, unsigned green,
                        unsigned blue, unsigned transp,
                        struct fb_info *fb_info)
{
#ifdef CONFIG_FB_MATROX_MULTIHEAD
      struct matrox_fb_info* minfo = container_of(fb_info, struct matrox_fb_info, fbcon);
#endif

      DBG(__func__)

      /*
       *  Set a single color register. The values supplied are
       *  already rounded down to the hardware's capabilities
       *  (according to the entries in the `var' structure). Return
       *  != 0 for invalid regno.
       */

      if (regno >= ACCESS_FBINFO(curr.cmap_len))
            return 1;

      if (ACCESS_FBINFO(fbcon).var.grayscale) {
            /* gray = 0.30*R + 0.59*G + 0.11*B */
            red = green = blue = (red * 77 + green * 151 + blue * 28) >> 8;
      }

      red = CNVT_TOHW(red, ACCESS_FBINFO(fbcon).var.red.length);
      green = CNVT_TOHW(green, ACCESS_FBINFO(fbcon).var.green.length);
      blue = CNVT_TOHW(blue, ACCESS_FBINFO(fbcon).var.blue.length);
      transp = CNVT_TOHW(transp, ACCESS_FBINFO(fbcon).var.transp.length);

      switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
      case 4:
      case 8:
            mga_outb(M_DAC_REG, regno);
            mga_outb(M_DAC_VAL, red);
            mga_outb(M_DAC_VAL, green);
            mga_outb(M_DAC_VAL, blue);
            break;
      case 16:
            if (regno >= 16)
                  break;
            {
                  u_int16_t col =
                        (red << ACCESS_FBINFO(fbcon).var.red.offset)     |
                        (green << ACCESS_FBINFO(fbcon).var.green.offset) |
                        (blue << ACCESS_FBINFO(fbcon).var.blue.offset)   |
                        (transp << ACCESS_FBINFO(fbcon).var.transp.offset); /* for 1:5:5:5 */
                  ACCESS_FBINFO(cmap[regno]) = col | (col << 16);
            }
            break;
      case 24:
      case 32:
            if (regno >= 16)
                  break;
            ACCESS_FBINFO(cmap[regno]) =
                  (red   << ACCESS_FBINFO(fbcon).var.red.offset)   |
                  (green << ACCESS_FBINFO(fbcon).var.green.offset) |
                  (blue  << ACCESS_FBINFO(fbcon).var.blue.offset)  |
                  (transp << ACCESS_FBINFO(fbcon).var.transp.offset);   /* 8:8:8:8 */
            break;
      }
      return 0;
}

static void matroxfb_init_fix(WPMINFO2)
{
      struct fb_fix_screeninfo *fix = &ACCESS_FBINFO(fbcon).fix;
      DBG(__func__)

      strcpy(fix->id,"MATROX");

      fix->xpanstep = 8;      /* 8 for 8bpp, 4 for 16bpp, 2 for 32bpp */
      fix->ypanstep = 1;
      fix->ywrapstep = 0;
      fix->mmio_start = ACCESS_FBINFO(mmio.base);
      fix->mmio_len = ACCESS_FBINFO(mmio.len);
      fix->accel = ACCESS_FBINFO(devflags.accelerator);
}

static void matroxfb_update_fix(WPMINFO2)
{
      struct fb_fix_screeninfo *fix = &ACCESS_FBINFO(fbcon).fix;
      DBG(__func__)

      mutex_lock(&ACCESS_FBINFO(fbcon).mm_lock);
      fix->smem_start = ACCESS_FBINFO(video.base) + ACCESS_FBINFO(curr.ydstorg.bytes);
      fix->smem_len = ACCESS_FBINFO(video.len_usable) - ACCESS_FBINFO(curr.ydstorg.bytes);
      mutex_unlock(&ACCESS_FBINFO(fbcon).mm_lock);
}

static int matroxfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info)
{
      int err;
      int visual;
      int cmap_len;
      unsigned int ydstorg;
      MINFO_FROM_INFO(info);

      if (ACCESS_FBINFO(dead)) {
            return -ENXIO;
      }
      if ((err = matroxfb_decode_var(PMINFO var, &visual, &cmap_len, &ydstorg)) != 0)
            return err;
      return 0;
}

static int matroxfb_set_par(struct fb_info *info)
{
      int err;
      int visual;
      int cmap_len;
      unsigned int ydstorg;
      struct fb_var_screeninfo *var;
      MINFO_FROM_INFO(info);

      DBG(__func__)

      if (ACCESS_FBINFO(dead)) {
            return -ENXIO;
      }

      var = &info->var;
      if ((err = matroxfb_decode_var(PMINFO var, &visual, &cmap_len, &ydstorg)) != 0)
            return err;
      ACCESS_FBINFO(fbcon.screen_base) = vaddr_va(ACCESS_FBINFO(video.vbase)) + ydstorg;
      matroxfb_update_fix(PMINFO2);
      ACCESS_FBINFO(fbcon).fix.visual = visual;
      ACCESS_FBINFO(fbcon).fix.type = FB_TYPE_PACKED_PIXELS;
      ACCESS_FBINFO(fbcon).fix.type_aux = 0;
      ACCESS_FBINFO(fbcon).fix.line_length = (var->xres_virtual * var->bits_per_pixel) >> 3;
      {
            unsigned int pos;

            ACCESS_FBINFO(curr.cmap_len) = cmap_len;
            ydstorg += ACCESS_FBINFO(devflags.ydstorg);
            ACCESS_FBINFO(curr.ydstorg.bytes) = ydstorg;
            ACCESS_FBINFO(curr.ydstorg.chunks) = ydstorg >> (isInterleave(MINFO)?3:2);
            if (var->bits_per_pixel == 4)
                  ACCESS_FBINFO(curr.ydstorg.pixels) = ydstorg;
            else
                  ACCESS_FBINFO(curr.ydstorg.pixels) = (ydstorg * 8) / var->bits_per_pixel;
            ACCESS_FBINFO(curr.final_bppShift) = matroxfb_get_final_bppShift(PMINFO var->bits_per_pixel);
            {     struct my_timming mt;
                  struct matrox_hw_state* hw;
                  int out;

                  matroxfb_var2my(var, &mt);
                  mt.crtc = MATROXFB_SRC_CRTC1;
                  /* CRTC1 delays */
                  switch (var->bits_per_pixel) {
                        case  0:    mt.delay = 31 + 0; break;
                        case 16:    mt.delay = 21 + 8; break;
                        case 24:    mt.delay = 17 + 8; break;
                        case 32:    mt.delay = 16 + 8; break;
                        default:    mt.delay = 31 + 8; break;
                  }

                  hw = &ACCESS_FBINFO(hw);

                  down_read(&ACCESS_FBINFO(altout).lock);
                  for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
                        if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
                            ACCESS_FBINFO(outputs[out]).output->compute) {
                              ACCESS_FBINFO(outputs[out]).output->compute(ACCESS_FBINFO(outputs[out]).data, &mt);
                        }
                  }
                  up_read(&ACCESS_FBINFO(altout).lock);
                  ACCESS_FBINFO(crtc1).pixclock = mt.pixclock;
                  ACCESS_FBINFO(crtc1).mnp = mt.mnp;
                  ACCESS_FBINFO(hw_switch->init(PMINFO &mt));
                  pos = (var->yoffset * var->xres_virtual + var->xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32;
                  pos += ACCESS_FBINFO(curr.ydstorg.chunks);

                  hw->CRTC[0x0D] = pos & 0xFF;
                  hw->CRTC[0x0C] = (pos & 0xFF00) >> 8;
                  hw->CRTCEXT[0] = (hw->CRTCEXT[0] & 0xF0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
                  hw->CRTCEXT[8] = pos >> 21;
                  ACCESS_FBINFO(hw_switch->restore(PMINFO2));
                  update_crtc2(PMINFO pos);
                  down_read(&ACCESS_FBINFO(altout).lock);
                  for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
                        if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
                            ACCESS_FBINFO(outputs[out]).output->program) {
                              ACCESS_FBINFO(outputs[out]).output->program(ACCESS_FBINFO(outputs[out]).data);
                        }
                  }
                  for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
                        if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
                            ACCESS_FBINFO(outputs[out]).output->start) {
                              ACCESS_FBINFO(outputs[out]).output->start(ACCESS_FBINFO(outputs[out]).data);
                        }
                  }
                  up_read(&ACCESS_FBINFO(altout).lock);
                  matrox_cfbX_init(PMINFO2);
            }
      }
      ACCESS_FBINFO(initialized) = 1;
      return 0;
}

static int matroxfb_get_vblank(WPMINFO struct fb_vblank *vblank)
{
      unsigned int sts1;

      matroxfb_enable_irq(PMINFO 0);
      memset(vblank, 0, sizeof(*vblank));
      vblank->flags = FB_VBLANK_HAVE_VCOUNT | FB_VBLANK_HAVE_VSYNC |
                  FB_VBLANK_HAVE_VBLANK | FB_VBLANK_HAVE_HBLANK;
      sts1 = mga_inb(M_INSTS1);
      vblank->vcount = mga_inl(M_VCOUNT);
      /* BTW, on my PIII/450 with G400, reading M_INSTS1
         byte makes this call about 12% slower (1.70 vs. 2.05 us
         per ioctl()) */
      if (sts1 & 1)
            vblank->flags |= FB_VBLANK_HBLANKING;
      if (sts1 & 8)
            vblank->flags |= FB_VBLANK_VSYNCING;
      if (vblank->vcount >= ACCESS_FBINFO(fbcon).var.yres)
            vblank->flags |= FB_VBLANK_VBLANKING;
      if (test_bit(0, &ACCESS_FBINFO(irq_flags))) {
            vblank->flags |= FB_VBLANK_HAVE_COUNT;
            /* Only one writer, aligned int value...
               it should work without lock and without atomic_t */
            vblank->count = ACCESS_FBINFO(crtc1).vsync.cnt;
      }
      return 0;
}

static struct matrox_altout panellink_output = {
      .name  = "Panellink output",
};

static int matroxfb_ioctl(struct fb_info *info,
                    unsigned int cmd, unsigned long arg)
{
      void __user *argp = (void __user *)arg;
      MINFO_FROM_INFO(info);

      DBG(__func__)

      if (ACCESS_FBINFO(dead)) {
            return -ENXIO;
      }

      switch (cmd) {
            case FBIOGET_VBLANK:
                  {
                        struct fb_vblank vblank;
                        int err;

                        err = matroxfb_get_vblank(PMINFO &vblank);
                        if (err)
                              return err;
                        if (copy_to_user(argp, &vblank, sizeof(vblank)))
                              return -EFAULT;
                        return 0;
                  }
            case FBIO_WAITFORVSYNC:
                  {
                        u_int32_t crt;

                        if (get_user(crt, (u_int32_t __user *)arg))
                              return -EFAULT;

                        return matroxfb_wait_for_sync(PMINFO crt);
                  }
            case MATROXFB_SET_OUTPUT_MODE:
                  {
                        struct matroxioc_output_mode mom;
                        struct matrox_altout *oproc;
                        int val;

                        if (copy_from_user(&mom, argp, sizeof(mom)))
                              return -EFAULT;
                        if (mom.output >= MATROXFB_MAX_OUTPUTS)
                              return -ENXIO;
                        down_read(&ACCESS_FBINFO(altout.lock));
                        oproc = ACCESS_FBINFO(outputs[mom.output]).output;
                        if (!oproc) {
                              val = -ENXIO;
                        } else if (!oproc->verifymode) {
                              if (mom.mode == MATROXFB_OUTPUT_MODE_MONITOR) {
                                    val = 0;
                              } else {
                                    val = -EINVAL;
                              }
                        } else {
                              val = oproc->verifymode(ACCESS_FBINFO(outputs[mom.output]).data, mom.mode);
                        }
                        if (!val) {
                              if (ACCESS_FBINFO(outputs[mom.output]).mode != mom.mode) {
                                    ACCESS_FBINFO(outputs[mom.output]).mode = mom.mode;
                                    val = 1;
                              }
                        }
                        up_read(&ACCESS_FBINFO(altout.lock));
                        if (val != 1)
                              return val;
                        switch (ACCESS_FBINFO(outputs[mom.output]).src) {
                              case MATROXFB_SRC_CRTC1:
                                    matroxfb_set_par(info);
                                    break;
                              case MATROXFB_SRC_CRTC2:
                                    {
                                          struct matroxfb_dh_fb_info* crtc2;

                                          down_read(&ACCESS_FBINFO(crtc2.lock));
                                          crtc2 = ACCESS_FBINFO(crtc2.info);
                                          if (crtc2)
                                                crtc2->fbcon.fbops->fb_set_par(&crtc2->fbcon);
                                          up_read(&ACCESS_FBINFO(crtc2.lock));
                                    }
                                    break;
                        }
                        return 0;
                  }
            case MATROXFB_GET_OUTPUT_MODE:
                  {
                        struct matroxioc_output_mode mom;
                        struct matrox_altout *oproc;
                        int val;

                        if (copy_from_user(&mom, argp, sizeof(mom)))
                              return -EFAULT;
                        if (mom.output >= MATROXFB_MAX_OUTPUTS)
                              return -ENXIO;
                        down_read(&ACCESS_FBINFO(altout.lock));
                        oproc = ACCESS_FBINFO(outputs[mom.output]).output;
                        if (!oproc) {
                              val = -ENXIO;
                        } else {
                              mom.mode = ACCESS_FBINFO(outputs[mom.output]).mode;
                              val = 0;
                        }
                        up_read(&ACCESS_FBINFO(altout.lock));
                        if (val)
                              return val;
                        if (copy_to_user(argp, &mom, sizeof(mom)))
                              return -EFAULT;
                        return 0;
                  }
            case MATROXFB_SET_OUTPUT_CONNECTION:
                  {
                        u_int32_t tmp;
                        int i;
                        int changes;

                        if (copy_from_user(&tmp, argp, sizeof(tmp)))
                              return -EFAULT;
                        for (i = 0; i < 32; i++) {
                              if (tmp & (1 << i)) {
                                    if (i >= MATROXFB_MAX_OUTPUTS)
                                          return -ENXIO;
                                    if (!ACCESS_FBINFO(outputs[i]).output)
                                          return -ENXIO;
                                    switch (ACCESS_FBINFO(outputs[i]).src) {
                                          case MATROXFB_SRC_NONE:
                                          case MATROXFB_SRC_CRTC1:
                                                break;
                                          default:
                                                return -EBUSY;
                                    }
                              }
                        }
                        if (ACCESS_FBINFO(devflags.panellink)) {
                              if (tmp & MATROXFB_OUTPUT_CONN_DFP) {
                                    if (tmp & MATROXFB_OUTPUT_CONN_SECONDARY)
                                          return -EINVAL;
                                    for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
                                          if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC2) {
                                                return -EBUSY;
                                          }
                                    }
                              }
                        }
                        changes = 0;
                        for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
                              if (tmp & (1 << i)) {
                                    if (ACCESS_FBINFO(outputs[i]).src != MATROXFB_SRC_CRTC1) {
                                          changes = 1;
                                          ACCESS_FBINFO(outputs[i]).src = MATROXFB_SRC_CRTC1;
                                    }
                              } else if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC1) {
                                    changes = 1;
                                    ACCESS_FBINFO(outputs[i]).src = MATROXFB_SRC_NONE;
                              }
                        }
                        if (!changes)
                              return 0;
                        matroxfb_set_par(info);
                        return 0;
                  }
            case MATROXFB_GET_OUTPUT_CONNECTION:
                  {
                        u_int32_t conn = 0;
                        int i;

                        for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
                              if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC1) {
                                    conn |= 1 << i;
                              }
                        }
                        if (put_user(conn, (u_int32_t __user *)arg))
                              return -EFAULT;
                        return 0;
                  }
            case MATROXFB_GET_AVAILABLE_OUTPUTS:
                  {
                        u_int32_t conn = 0;
                        int i;

                        for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
                              if (ACCESS_FBINFO(outputs[i]).output) {
                                    switch (ACCESS_FBINFO(outputs[i]).src) {
                                          case MATROXFB_SRC_NONE:
                                          case MATROXFB_SRC_CRTC1:
                                                conn |= 1 << i;
                                                break;
                                    }
                              }
                        }
                        if (ACCESS_FBINFO(devflags.panellink)) {
                              if (conn & MATROXFB_OUTPUT_CONN_DFP)
                                    conn &= ~MATROXFB_OUTPUT_CONN_SECONDARY;
                              if (conn & MATROXFB_OUTPUT_CONN_SECONDARY)
                                    conn &= ~MATROXFB_OUTPUT_CONN_DFP;
                        }
                        if (put_user(conn, (u_int32_t __user *)arg))
                              return -EFAULT;
                        return 0;
                  }
            case MATROXFB_GET_ALL_OUTPUTS:
                  {
                        u_int32_t conn = 0;
                        int i;

                        for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
                              if (ACCESS_FBINFO(outputs[i]).output) {
                                    conn |= 1 << i;
                              }
                        }
                        if (put_user(conn, (u_int32_t __user *)arg))
                              return -EFAULT;
                        return 0;
                  }
            case VIDIOC_QUERYCAP:
                  {
                        struct v4l2_capability r;

                        memset(&r, 0, sizeof(r));
                        strcpy(r.driver, "matroxfb");
                        strcpy(r.card, "Matrox");
                        sprintf(r.bus_info, "PCI:%s", pci_name(ACCESS_FBINFO(pcidev)));
                        r.version = KERNEL_VERSION(1,0,0);
                        r.capabilities = V4L2_CAP_VIDEO_OUTPUT;
                        if (copy_to_user(argp, &r, sizeof(r)))
                              return -EFAULT;
                        return 0;

                  }
            case VIDIOC_QUERYCTRL:
                  {
                        struct v4l2_queryctrl qctrl;
                        int err;

                        if (copy_from_user(&qctrl, argp, sizeof(qctrl)))
                              return -EFAULT;

                        down_read(&ACCESS_FBINFO(altout).lock);
                        if (!ACCESS_FBINFO(outputs[1]).output) {
                              err = -ENXIO;
                        } else if (ACCESS_FBINFO(outputs[1]).output->getqueryctrl) {
                              err = ACCESS_FBINFO(outputs[1]).output->getqueryctrl(ACCESS_FBINFO(outputs[1]).data, &qctrl);
                        } else {
                              err = -EINVAL;
                        }
                        up_read(&ACCESS_FBINFO(altout).lock);
                        if (err >= 0 &&
                            copy_to_user(argp, &qctrl, sizeof(qctrl)))
                              return -EFAULT;
                        return err;
                  }
            case VIDIOC_G_CTRL:
                  {
                        struct v4l2_control ctrl;
                        int err;

                        if (copy_from_user(&ctrl, argp, sizeof(ctrl)))
                              return -EFAULT;

                        down_read(&ACCESS_FBINFO(altout).lock);
                        if (!ACCESS_FBINFO(outputs[1]).output) {
                              err = -ENXIO;
                        } else if (ACCESS_FBINFO(outputs[1]).output->getctrl) {
                              err = ACCESS_FBINFO(outputs[1]).output->getctrl(ACCESS_FBINFO(outputs[1]).data, &ctrl);
                        } else {
                              err = -EINVAL;
                        }
                        up_read(&ACCESS_FBINFO(altout).lock);
                        if (err >= 0 &&
                            copy_to_user(argp, &ctrl, sizeof(ctrl)))
                              return -EFAULT;
                        return err;
                  }
            case VIDIOC_S_CTRL_OLD:
            case VIDIOC_S_CTRL:
                  {
                        struct v4l2_control ctrl;
                        int err;

                        if (copy_from_user(&ctrl, argp, sizeof(ctrl)))
                              return -EFAULT;

                        down_read(&ACCESS_FBINFO(altout).lock);
                        if (!ACCESS_FBINFO(outputs[1]).output) {
                              err = -ENXIO;
                        } else if (ACCESS_FBINFO(outputs[1]).output->setctrl) {
                              err = ACCESS_FBINFO(outputs[1]).output->setctrl(ACCESS_FBINFO(outputs[1]).data, &ctrl);
                        } else {
                              err = -EINVAL;
                        }
                        up_read(&ACCESS_FBINFO(altout).lock);
                        return err;
                  }
      }
      return -ENOTTY;
}

/* 0 unblank, 1 blank, 2 no vsync, 3 no hsync, 4 off */

static int matroxfb_blank(int blank, struct fb_info *info)
{
      int seq;
      int crtc;
      CRITFLAGS
      MINFO_FROM_INFO(info);

      DBG(__func__)

      if (ACCESS_FBINFO(dead))
            return 1;

      switch (blank) {
      case FB_BLANK_NORMAL:  seq = 0x20; crtc = 0x00; break; /* works ??? */
      case FB_BLANK_VSYNC_SUSPEND:  seq = 0x20; crtc = 0x10; break;
      case FB_BLANK_HSYNC_SUSPEND:  seq = 0x20; crtc = 0x20; break;
      case FB_BLANK_POWERDOWN:  seq = 0x20; crtc = 0x30; break;
      default: seq = 0x00; crtc = 0x00; break;
      }

      CRITBEGIN

      mga_outb(M_SEQ_INDEX, 1);
      mga_outb(M_SEQ_DATA, (mga_inb(M_SEQ_DATA) & ~0x20) | seq);
      mga_outb(M_EXTVGA_INDEX, 1);
      mga_outb(M_EXTVGA_DATA, (mga_inb(M_EXTVGA_DATA) & ~0x30) | crtc);

      CRITEND
      return 0;
}

static struct fb_ops matroxfb_ops = {
      .owner =    THIS_MODULE,
      .fb_open =  matroxfb_open,
      .fb_release =     matroxfb_release,
      .fb_check_var =   matroxfb_check_var,
      .fb_set_par =     matroxfb_set_par,
      .fb_setcolreg =   matroxfb_setcolreg,
      .fb_pan_display =matroxfb_pan_display,
      .fb_blank = matroxfb_blank,
      .fb_ioctl = matroxfb_ioctl,
/*    .fb_fillrect =    <set by matrox_cfbX_init>, */
/*    .fb_copyarea =    <set by matrox_cfbX_init>, */
/*    .fb_imageblit =   <set by matrox_cfbX_init>, */
/*    .fb_cursor =      <set by matrox_cfbX_init>, */
};

#define RSDepth(X)      (((X) >> 8) & 0x0F)
#define RS8bpp          0x1
#define RS15bpp         0x2
#define RS16bpp         0x3
#define RS32bpp         0x4
#define RS4bpp          0x5
#define RS24bpp         0x6
#define RSText          0x7
#define RSText8         0x8
/* 9-F */
static struct { struct fb_bitfield red, green, blue, transp; int bits_per_pixel; } colors[] = {
      { {  0, 8, 0}, { 0, 8, 0}, { 0, 8, 0}, {  0, 0, 0},  8 },
      { { 10, 5, 0}, { 5, 5, 0}, { 0, 5, 0}, { 15, 1, 0}, 16 },
      { { 11, 5, 0}, { 5, 6, 0}, { 0, 5, 0}, {  0, 0, 0}, 16 },
      { { 16, 8, 0}, { 8, 8, 0}, { 0, 8, 0}, { 24, 8, 0}, 32 },
      { {  0, 8, 0}, { 0, 8, 0}, { 0, 8, 0}, {  0, 0, 0},  4 },
      { { 16, 8, 0}, { 8, 8, 0}, { 0, 8, 0}, {  0, 0, 0}, 24 },
      { {  0, 6, 0}, { 0, 6, 0}, { 0, 6, 0}, {  0, 0, 0},  0 },   /* textmode with (default) VGA8x16 */
      { {  0, 6, 0}, { 0, 6, 0}, { 0, 6, 0}, {  0, 0, 0},  0 },   /* textmode hardwired to VGA8x8 */
};

/* initialized by setup, see explanation at end of file (search for MODULE_PARM_DESC) */
static unsigned int mem;            /* "matrox:mem:xxxxxM" */
static int option_precise_width = 1;      /* cannot be changed, option_precise_width==0 must imply noaccel */
static int inv24;             /* "matrox:inv24" */
static int cross4MB = -1;           /* "matrox:cross4MB" */
static int disabled;                /* "matrox:disabled" */
static int noaccel;                 /* "matrox:noaccel" */
static int nopan;             /* "matrox:nopan" */
static int no_pci_retry;            /* "matrox:nopciretry" */
static int novga;             /* "matrox:novga" */
static int nobios;                  /* "matrox:nobios" */
static int noinit = 1;              /* "matrox:init" */
static int inverse;                 /* "matrox:inverse" */
static int sgram;             /* "matrox:sgram" */
#ifdef CONFIG_MTRR
static int mtrr = 1;                /* "matrox:nomtrr" */
#endif
static int grayscale;               /* "matrox:grayscale" */
static int dev = -1;                /* "matrox:dev:xxxxx" */
static unsigned int vesa = ~0;            /* "matrox:vesa:xxxxx" */
static int depth = -1;              /* "matrox:depth:xxxxx" */
static unsigned int xres;           /* "matrox:xres:xxxxx" */
static unsigned int yres;           /* "matrox:yres:xxxxx" */
static unsigned int upper = ~0;           /* "matrox:upper:xxxxx" */
static unsigned int lower = ~0;           /* "matrox:lower:xxxxx" */
static unsigned int vslen;          /* "matrox:vslen:xxxxx" */
static unsigned int left = ~0;            /* "matrox:left:xxxxx" */
static unsigned int right = ~0;           /* "matrox:right:xxxxx" */
static unsigned int hslen;          /* "matrox:hslen:xxxxx" */
static unsigned int pixclock;       /* "matrox:pixclock:xxxxx" */
static int sync = -1;               /* "matrox:sync:xxxxx" */
static unsigned int fv;             /* "matrox:fv:xxxxx" */
static unsigned int fh;             /* "matrox:fh:xxxxxk" */
static unsigned int maxclk;         /* "matrox:maxclk:xxxxM" */
static int dfp;                     /* "matrox:dfp */
static int dfp_type = -1;           /* "matrox:dfp:xxx */
static int memtype = -1;            /* "matrox:memtype:xxx" */
static char outputs[8];             /* "matrox:outputs:xxx" */

#ifndef MODULE
static char videomode[64];          /* "matrox:mode:xxxxx" or "matrox:xxxxx" */
#endif

static int matroxfb_getmemory(WPMINFO unsigned int maxSize, unsigned int *realSize){
      vaddr_t vm;
      unsigned int offs;
      unsigned int offs2;
      unsigned char orig;
      unsigned char bytes[32];
      unsigned char* tmp;

      DBG(__func__)

      vm = ACCESS_FBINFO(video.vbase);
      maxSize &= ~0x1FFFFF;   /* must be X*2MB (really it must be 2 or X*4MB) */
      /* at least 2MB */
      if (maxSize < 0x0200000) return 0;
      if (maxSize > 0x2000000) maxSize = 0x2000000;

      mga_outb(M_EXTVGA_INDEX, 0x03);
      orig = mga_inb(M_EXTVGA_DATA);
      mga_outb(M_EXTVGA_DATA, orig | 0x80);

      tmp = bytes;
      for (offs = 0x100000; offs < maxSize; offs += 0x200000)
            *tmp++ = mga_readb(vm, offs);
      for (offs = 0x100000; offs < maxSize; offs += 0x200000)
            mga_writeb(vm, offs, 0x02);
      mga_outb(M_CACHEFLUSH, 0x00);
      for (offs = 0x100000; offs < maxSize; offs += 0x200000) {
            if (mga_readb(vm, offs) != 0x02)
                  break;
            mga_writeb(vm, offs, mga_readb(vm, offs) - 0x02);
            if (mga_readb(vm, offs))
                  break;
      }
      tmp = bytes;
      for (offs2 = 0x100000; offs2 < maxSize; offs2 += 0x200000)
            mga_writeb(vm, offs2, *tmp++);

      mga_outb(M_EXTVGA_INDEX, 0x03);
      mga_outb(M_EXTVGA_DATA, orig);

      *realSize = offs - 0x100000;
#ifdef CONFIG_FB_MATROX_MILLENIUM
      ACCESS_FBINFO(interleave) = !(!isMillenium(MINFO) || ((offs - 0x100000) & 0x3FFFFF));
#endif
      return 1;
}

01331 struct video_board {
      int maxvram;
      int maxdisplayable;
      int accelID;
      struct matrox_switch* lowlevel;
             };
#ifdef CONFIG_FB_MATROX_MILLENIUM
static struct video_board vbMillennium          = {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGA2064W,    &matrox_millennium};
static struct video_board vbMillennium2         = {0x1000000, 0x0800000, FB_ACCEL_MATROX_MGA2164W,    &matrox_millennium};
static struct video_board vbMillennium2A  = {0x1000000, 0x0800000, FB_ACCEL_MATROX_MGA2164W_AGP,      &matrox_millennium};
#endif      /* CONFIG_FB_MATROX_MILLENIUM */
#ifdef CONFIG_FB_MATROX_MYSTIQUE
static struct video_board vbMystique            = {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGA1064SG,   &matrox_mystique};
#endif      /* CONFIG_FB_MATROX_MYSTIQUE */
#ifdef CONFIG_FB_MATROX_G
static struct video_board vbG100          = {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGAG100,     &matrox_G100};
static struct video_board vbG200          = {0x1000000, 0x1000000, FB_ACCEL_MATROX_MGAG200,     &matrox_G100};
#ifdef CONFIG_FB_MATROX_32MB
/* from doc it looks like that accelerator can draw only to low 16MB :-( Direct accesses & displaying are OK for
   whole 32MB */
static struct video_board vbG400          = {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400,     &matrox_G100};
#else
static struct video_board vbG400          = {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400,     &matrox_G100};
#endif
#endif

#define DEVF_VIDEO64BIT       0x0001
#define     DEVF_SWAPS        0x0002
#define DEVF_SRCORG           0x0004
#define DEVF_DUALHEAD         0x0008
#define DEVF_CROSS4MB         0x0010
#define DEVF_TEXT4B           0x0020
/* #define DEVF_recycled      0x0040      */
/* #define DEVF_recycled      0x0080      */
#define DEVF_SUPPORT32MB      0x0100
#define DEVF_ANY_VXRES        0x0200
#define DEVF_TEXT16B          0x0400
#define DEVF_CRTC2            0x0800
#define DEVF_MAVEN_CAPABLE    0x1000
#define DEVF_PANELLINK_CAPABLE      0x2000
#define DEVF_G450DAC          0x4000

#define DEVF_GCORE      (DEVF_VIDEO64BIT | DEVF_SWAPS | DEVF_CROSS4MB)
#define DEVF_G2CORE     (DEVF_GCORE | DEVF_ANY_VXRES | DEVF_MAVEN_CAPABLE | DEVF_PANELLINK_CAPABLE | DEVF_SRCORG | DEVF_DUALHEAD)
#define DEVF_G100 (DEVF_GCORE) /* no doc, no vxres... */
#define DEVF_G200 (DEVF_G2CORE)
#define DEVF_G400 (DEVF_G2CORE | DEVF_SUPPORT32MB | DEVF_TEXT16B | DEVF_CRTC2)
/* if you'll find how to drive DFP... */
#define DEVF_G450 (DEVF_GCORE | DEVF_ANY_VXRES | DEVF_SUPPORT32MB | DEVF_TEXT16B | DEVF_CRTC2 | DEVF_G450DAC | DEVF_SRCORG | DEVF_DUALHEAD)
#define DEVF_G550 (DEVF_G450)

static struct board {
      unsigned short vendor, device, rev, svid, sid;
      unsigned int flags;
      unsigned int maxclk;
      enum mga_chip chip;
      struct video_board* base;
      const char* name;
            } dev_list[] = {
#ifdef CONFIG_FB_MATROX_MILLENIUM
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_MIL,     0xFF,
            0,                0,
            DEVF_TEXT4B,
            230000,
            MGA_2064,
            &vbMillennium,
            "Millennium (PCI)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_MIL_2,   0xFF,
            0,                0,
            DEVF_SWAPS,
            220000,
            MGA_2164,
            &vbMillennium2,
            "Millennium II (PCI)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_MIL_2_AGP,     0xFF,
            0,                0,
            DEVF_SWAPS,
            250000,
            MGA_2164,
            &vbMillennium2A,
            "Millennium II (AGP)"},
#endif
#ifdef CONFIG_FB_MATROX_MYSTIQUE
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_MYS,     0x02,
            0,                0,
            DEVF_VIDEO64BIT | DEVF_CROSS4MB,
            180000,
            MGA_1064,
            &vbMystique,
            "Mystique (PCI)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_MYS,     0xFF,
            0,                0,
            DEVF_VIDEO64BIT | DEVF_SWAPS | DEVF_CROSS4MB,
            220000,
            MGA_1164,
            &vbMystique,
            "Mystique 220 (PCI)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_MYS_AGP, 0x02,
            0,                0,
            DEVF_VIDEO64BIT | DEVF_CROSS4MB,
            180000,
            MGA_1064,
            &vbMystique,
            "Mystique (AGP)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_MYS_AGP, 0xFF,
            0,                0,
            DEVF_VIDEO64BIT | DEVF_SWAPS | DEVF_CROSS4MB,
            220000,
            MGA_1164,
            &vbMystique,
            "Mystique 220 (AGP)"},
#endif
#ifdef CONFIG_FB_MATROX_G
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G100_MM, 0xFF,
            0,                0,
            DEVF_G100,
            230000,
            MGA_G100,
            &vbG100,
            "MGA-G100 (PCI)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G100_AGP,      0xFF,
            0,                0,
            DEVF_G100,
            230000,
            MGA_G100,
            &vbG100,
            "MGA-G100 (AGP)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G200EV_PCI,    0xFF,
            0,                0,
            DEVF_G200,
            230000,
            MGA_G200,
            &vbG200,
            "MGA-G200eV (PCI)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G200_PCI,      0xFF,
            0,                0,
            DEVF_G200,
            250000,
            MGA_G200,
            &vbG200,
            "MGA-G200 (PCI)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G200_AGP,      0xFF,
            PCI_SS_VENDOR_ID_MATROX,      PCI_SS_ID_MATROX_GENERIC,
            DEVF_G200,
            220000,
            MGA_G200,
            &vbG200,
            "MGA-G200 (AGP)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G200_AGP,      0xFF,
            PCI_SS_VENDOR_ID_MATROX,      PCI_SS_ID_MATROX_MYSTIQUE_G200_AGP,
            DEVF_G200,
            230000,
            MGA_G200,
            &vbG200,
            "Mystique G200 (AGP)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G200_AGP,      0xFF,
            PCI_SS_VENDOR_ID_MATROX,      PCI_SS_ID_MATROX_MILLENIUM_G200_AGP,
            DEVF_G200,
            250000,
            MGA_G200,
            &vbG200,
            "Millennium G200 (AGP)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G200_AGP,      0xFF,
            PCI_SS_VENDOR_ID_MATROX,      PCI_SS_ID_MATROX_MARVEL_G200_AGP,
            DEVF_G200,
            230000,
            MGA_G200,
            &vbG200,
            "Marvel G200 (AGP)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G200_AGP,      0xFF,
            PCI_SS_VENDOR_ID_SIEMENS_NIXDORF,   PCI_SS_ID_SIEMENS_MGA_G200_AGP,
            DEVF_G200,
            230000,
            MGA_G200,
            &vbG200,
            "MGA-G200 (AGP)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G200_AGP,      0xFF,
            0,                0,
            DEVF_G200,
            230000,
            MGA_G200,
            &vbG200,
            "G200 (AGP)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G400,    0x80,
            PCI_SS_VENDOR_ID_MATROX,      PCI_SS_ID_MATROX_MILLENNIUM_G400_MAX_AGP,
            DEVF_G400,
            360000,
            MGA_G400,
            &vbG400,
            "Millennium G400 MAX (AGP)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G400,    0x80,
            0,                0,
            DEVF_G400,
            300000,
            MGA_G400,
            &vbG400,
            "G400 (AGP)"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G400,    0xFF,
            0,                0,
            DEVF_G450,
            360000,
            MGA_G450,
            &vbG400,
            "G450"},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G550,    0xFF,
            0,                0,
            DEVF_G550,
            360000,
            MGA_G550,
            &vbG400,
            "G550"},
#endif
      {0,               0,                      0xFF,
            0,                0,
            0,
            0,
            0,
            NULL,
            NULL}};

#ifndef MODULE
static struct fb_videomode defaultmode = {
      /* 640x480 @ 60Hz, 31.5 kHz */
      NULL, 60, 640, 480, 39721, 40, 24, 32, 11, 96, 2,
      0, FB_VMODE_NONINTERLACED
};
#endif /* !MODULE */

static int hotplug = 0;

static void setDefaultOutputs(WPMINFO2) {
      unsigned int i;
      const char* ptr;

      ACCESS_FBINFO(outputs[0]).default_src = MATROXFB_SRC_CRTC1;
      if (ACCESS_FBINFO(devflags.g450dac)) {
            ACCESS_FBINFO(outputs[1]).default_src = MATROXFB_SRC_CRTC1;
            ACCESS_FBINFO(outputs[2]).default_src = MATROXFB_SRC_CRTC1;
      } else if (dfp) {
            ACCESS_FBINFO(outputs[2]).default_src = MATROXFB_SRC_CRTC1;
      }
      ptr = outputs;
      for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
            char c = *ptr++;

            if (c == 0) {
                  break;
            }
            if (c == '0') {
                  ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_NONE;
            } else if (c == '1') {
                  ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_CRTC1;
            } else if (c == '2' && ACCESS_FBINFO(devflags.crtc2)) {
                  ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_CRTC2;
            } else {
                  printk(KERN_ERR "matroxfb: Unknown outputs setting\n");
                  break;
            }
      }
      /* Nullify this option for subsequent adapters */
      outputs[0] = 0;
}

static int initMatrox2(WPMINFO struct board* b){
      unsigned long ctrlptr_phys = 0;
      unsigned long video_base_phys = 0;
      unsigned int memsize;
      int err;

      static struct pci_device_id intel_82437[] = {
            { PCI_DEVICE(PCI_VENDOR_ID_INTEL, PCI_DEVICE_ID_INTEL_82437) },
            { },
      };

      DBG(__func__)

      /* set default values... */
      vesafb_defined.accel_flags = FB_ACCELF_TEXT;

      ACCESS_FBINFO(hw_switch) = b->base->lowlevel;
      ACCESS_FBINFO(devflags.accelerator) = b->base->accelID;
      ACCESS_FBINFO(max_pixel_clock) = b->maxclk;

      printk(KERN_INFO "matroxfb: Matrox %s detected\n", b->name);
      ACCESS_FBINFO(capable.plnwt) = 1;
      ACCESS_FBINFO(chip) = b->chip;
      ACCESS_FBINFO(capable.srcorg) = b->flags & DEVF_SRCORG;
      ACCESS_FBINFO(devflags.video64bits) = b->flags & DEVF_VIDEO64BIT;
      if (b->flags & DEVF_TEXT4B) {
            ACCESS_FBINFO(devflags.vgastep) = 4;
            ACCESS_FBINFO(devflags.textmode) = 4;
            ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16;
      } else if (b->flags & DEVF_TEXT16B) {
            ACCESS_FBINFO(devflags.vgastep) = 16;
            ACCESS_FBINFO(devflags.textmode) = 1;
            ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16;
      } else {
            ACCESS_FBINFO(devflags.vgastep) = 8;
            ACCESS_FBINFO(devflags.textmode) = 1;
            ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP8;
      }
#ifdef CONFIG_FB_MATROX_32MB
      ACCESS_FBINFO(devflags.support32MB) = (b->flags & DEVF_SUPPORT32MB) != 0;
#endif
      ACCESS_FBINFO(devflags.precise_width) = !(b->flags & DEVF_ANY_VXRES);
      ACCESS_FBINFO(devflags.crtc2) = (b->flags & DEVF_CRTC2) != 0;
      ACCESS_FBINFO(devflags.maven_capable) = (b->flags & DEVF_MAVEN_CAPABLE) != 0;
      ACCESS_FBINFO(devflags.dualhead) = (b->flags & DEVF_DUALHEAD) != 0;
      ACCESS_FBINFO(devflags.dfp_type) = dfp_type;
      ACCESS_FBINFO(devflags.g450dac) = (b->flags & DEVF_G450DAC) != 0;
      ACCESS_FBINFO(devflags.textstep) = ACCESS_FBINFO(devflags.vgastep) * ACCESS_FBINFO(devflags.textmode);
      ACCESS_FBINFO(devflags.textvram) = 65536 / ACCESS_FBINFO(devflags.textmode);
      setDefaultOutputs(PMINFO2);
      if (b->flags & DEVF_PANELLINK_CAPABLE) {
            ACCESS_FBINFO(outputs[2]).data = MINFO;
            ACCESS_FBINFO(outputs[2]).output = &panellink_output;
            ACCESS_FBINFO(outputs[2]).src = ACCESS_FBINFO(outputs[2]).default_src;
            ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
            ACCESS_FBINFO(devflags.panellink) = 1;
      }

      if (ACCESS_FBINFO(capable.cross4MB) < 0)
            ACCESS_FBINFO(capable.cross4MB) = b->flags & DEVF_CROSS4MB;
      if (b->flags & DEVF_SWAPS) {
            ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1);
            video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0);
            ACCESS_FBINFO(devflags.fbResource) = PCI_BASE_ADDRESS_0;
      } else {
            ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0);
            video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1);
            ACCESS_FBINFO(devflags.fbResource) = PCI_BASE_ADDRESS_1;
      }
      err = -EINVAL;
      if (!ctrlptr_phys) {
            printk(KERN_ERR "matroxfb: control registers are not available, matroxfb disabled\n");
            goto fail;
      }
      if (!video_base_phys) {
            printk(KERN_ERR "matroxfb: video RAM is not available in PCI address space, matroxfb disabled\n");
            goto fail;
      }
      memsize = b->base->maxvram;
      if (!request_mem_region(ctrlptr_phys, 16384, "matroxfb MMIO")) {
            goto fail;
      }
      if (!request_mem_region(video_base_phys, memsize, "matroxfb FB")) {
            goto failCtrlMR;
      }
      ACCESS_FBINFO(video.len_maximum) = memsize;
      /* convert mem (autodetect k, M) */
      if (mem < 1024) mem *= 1024;
      if (mem < 0x00100000) mem *= 1024;

      if (mem && (mem < memsize))
            memsize = mem;
      err = -ENOMEM;
      if (mga_ioremap(ctrlptr_phys, 16384, MGA_IOREMAP_MMIO, &ACCESS_FBINFO(mmio.vbase))) {
            printk(KERN_ERR "matroxfb: cannot ioremap(%lX, 16384), matroxfb disabled\n", ctrlptr_phys);
            goto failVideoMR;
      }
      ACCESS_FBINFO(mmio.base) = ctrlptr_phys;
      ACCESS_FBINFO(mmio.len) = 16384;
      ACCESS_FBINFO(video.base) = video_base_phys;
      if (mga_ioremap(video_base_phys, memsize, MGA_IOREMAP_FB, &ACCESS_FBINFO(video.vbase))) {
            printk(KERN_ERR "matroxfb: cannot ioremap(%lX, %d), matroxfb disabled\n",
                  video_base_phys, memsize);
            goto failCtrlIO;
      }
      {
            u_int32_t cmd;
            u_int32_t mga_option;

            pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, &mga_option);
            pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, &cmd);
            mga_option &= 0x7FFFFFFF; /* clear BIG_ENDIAN */
            mga_option |= MX_OPTION_BSWAP;
            /* disable palette snooping */
            cmd &= ~PCI_COMMAND_VGA_PALETTE;
            if (pci_dev_present(intel_82437)) {
                  if (!(mga_option & 0x20000000) && !ACCESS_FBINFO(devflags.nopciretry)) {
                        printk(KERN_WARNING "matroxfb: Disabling PCI retries due to i82437 present\n");
                  }
                  mga_option |= 0x20000000;
                  ACCESS_FBINFO(devflags.nopciretry) = 1;
            }
            pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, cmd);
            pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mga_option);
            ACCESS_FBINFO(hw).MXoptionReg = mga_option;

            /* select non-DMA memory for PCI_MGA_DATA, otherwise dump of PCI cfg space can lock PCI bus */
            /* maybe preinit() candidate, but it is same... for all devices... at this time... */
            pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MGA_INDEX, 0x00003C00);
      }

      err = -ENXIO;
      matroxfb_read_pins(PMINFO2);
      if (ACCESS_FBINFO(hw_switch)->preinit(PMINFO2)) {
            goto failVideoIO;
      }

      err = -ENOMEM;
      if (!matroxfb_getmemory(PMINFO memsize, &ACCESS_FBINFO(video.len)) || !ACCESS_FBINFO(video.len)) {
            printk(KERN_ERR "matroxfb: cannot determine memory size\n");
            goto failVideoIO;
      }
      ACCESS_FBINFO(devflags.ydstorg) = 0;

      ACCESS_FBINFO(video.base) = video_base_phys;
      ACCESS_FBINFO(video.len_usable) = ACCESS_FBINFO(video.len);
      if (ACCESS_FBINFO(video.len_usable) > b->base->maxdisplayable)
            ACCESS_FBINFO(video.len_usable) = b->base->maxdisplayable;
#ifdef CONFIG_MTRR
      if (mtrr) {
            ACCESS_FBINFO(mtrr.vram) = mtrr_add(video_base_phys, ACCESS_FBINFO(video.len), MTRR_TYPE_WRCOMB, 1);
            ACCESS_FBINFO(mtrr.vram_valid) = 1;
            printk(KERN_INFO "matroxfb: MTRR's turned on\n");
      }
#endif      /* CONFIG_MTRR */

      if (!ACCESS_FBINFO(devflags.novga))
            request_region(0x3C0, 32, "matrox");
      matroxfb_g450_connect(PMINFO2);
      ACCESS_FBINFO(hw_switch->reset(PMINFO2));

      ACCESS_FBINFO(fbcon.monspecs.hfmin) = 0;
      ACCESS_FBINFO(fbcon.monspecs.hfmax) = fh;
      ACCESS_FBINFO(fbcon.monspecs.vfmin) = 0;
      ACCESS_FBINFO(fbcon.monspecs.vfmax) = fv;
      ACCESS_FBINFO(fbcon.monspecs.dpms) = 0;   /* TBD */

      /* static settings */
      vesafb_defined.red = colors[depth-1].red;
      vesafb_defined.green = colors[depth-1].green;
      vesafb_defined.blue = colors[depth-1].blue;
      vesafb_defined.bits_per_pixel = colors[depth-1].bits_per_pixel;
      vesafb_defined.grayscale = grayscale;
      vesafb_defined.vmode = 0;
      if (noaccel)
            vesafb_defined.accel_flags &= ~FB_ACCELF_TEXT;

      ACCESS_FBINFO(fbops) = matroxfb_ops;
      ACCESS_FBINFO(fbcon.fbops) = &ACCESS_FBINFO(fbops);
      ACCESS_FBINFO(fbcon.pseudo_palette) = ACCESS_FBINFO(cmap);
      /* after __init time we are like module... no logo */
      ACCESS_FBINFO(fbcon.flags) = hotplug ? FBINFO_FLAG_MODULE : FBINFO_FLAG_DEFAULT;
      ACCESS_FBINFO(fbcon.flags) |= FBINFO_PARTIAL_PAN_OK |        /* Prefer panning for scroll under MC viewer/edit */
                              FBINFO_HWACCEL_COPYAREA |  /* We have hw-assisted bmove */
                              FBINFO_HWACCEL_FILLRECT |  /* And fillrect */
                              FBINFO_HWACCEL_IMAGEBLIT | /* And imageblit */
                              FBINFO_HWACCEL_XPAN |      /* And we support both horizontal */
                              FBINFO_HWACCEL_YPAN;       /* And vertical panning */
      ACCESS_FBINFO(video.len_usable) &= PAGE_MASK;
      fb_alloc_cmap(&ACCESS_FBINFO(fbcon.cmap), 256, 1);

#ifndef MODULE
      /* mode database is marked __init!!! */
      if (!hotplug) {
            fb_find_mode(&vesafb_defined, &ACCESS_FBINFO(fbcon), videomode[0]?videomode:NULL,
                  NULL, 0, &defaultmode, vesafb_defined.bits_per_pixel);
      }
#endif /* !MODULE */

      /* mode modifiers */
      if (hslen)
            vesafb_defined.hsync_len = hslen;
      if (vslen)
            vesafb_defined.vsync_len = vslen;
      if (left != ~0)
            vesafb_defined.left_margin = left;
      if (right != ~0)
            vesafb_defined.right_margin = right;
      if (upper != ~0)
            vesafb_defined.upper_margin = upper;
      if (lower != ~0)
            vesafb_defined.lower_margin = lower;
      if (xres)
            vesafb_defined.xres = xres;
      if (yres)
            vesafb_defined.yres = yres;
      if (sync != -1)
            vesafb_defined.sync = sync;
      else if (vesafb_defined.sync == ~0) {
            vesafb_defined.sync = 0;
            if (yres < 400)
                  vesafb_defined.sync |= FB_SYNC_HOR_HIGH_ACT;
            else if (yres < 480)
                  vesafb_defined.sync |= FB_SYNC_VERT_HIGH_ACT;
      }

      /* fv, fh, maxclk limits was specified */
      {
            unsigned int tmp;

            if (fv) {
                  tmp = fv * (vesafb_defined.upper_margin + vesafb_defined.yres
                          + vesafb_defined.lower_margin + vesafb_defined.vsync_len);
                  if ((tmp < fh) || (fh == 0)) fh = tmp;
            }
            if (fh) {
                  tmp = fh * (vesafb_defined.left_margin + vesafb_defined.xres
                          + vesafb_defined.right_margin + vesafb_defined.hsync_len);
                  if ((tmp < maxclk) || (maxclk == 0)) maxclk = tmp;
            }
            tmp = (maxclk + 499) / 500;
            if (tmp) {
                  tmp = (2000000000 + tmp) / tmp;
                  if (tmp > pixclock) pixclock = tmp;
            }
      }
      if (pixclock) {
            if (pixclock < 2000)          /* > 500MHz */
                  pixclock = 4000;  /* 250MHz */
            if (pixclock > 1000000)
                  pixclock = 1000000;     /* 1MHz */
            vesafb_defined.pixclock = pixclock;
      }

      /* FIXME: Where to move this?! */
#if defined(CONFIG_PPC_PMAC)
#ifndef MODULE
      if (machine_is(powermac)) {
            struct fb_var_screeninfo var;
            if (default_vmode <= 0 || default_vmode > VMODE_MAX)
                  default_vmode = VMODE_640_480_60;
#ifdef CONFIG_NVRAM
            if (default_cmode == CMODE_NVRAM)
                  default_cmode = nvram_read_byte(NV_CMODE);
#endif
            if (default_cmode < CMODE_8 || default_cmode > CMODE_32)
                  default_cmode = CMODE_8;
            if (!mac_vmode_to_var(default_vmode, default_cmode, &var)) {
                  var.accel_flags = vesafb_defined.accel_flags;
                  var.xoffset = var.yoffset = 0;
                  /* Note: mac_vmode_to_var() does not set all parameters */
                  vesafb_defined = var;
            }
      }
#endif /* !MODULE */
#endif /* CONFIG_PPC_PMAC */
      vesafb_defined.xres_virtual = vesafb_defined.xres;
      if (nopan) {
            vesafb_defined.yres_virtual = vesafb_defined.yres;
      } else {
            vesafb_defined.yres_virtual = 65536; /* large enough to be INF, but small enough
                                          to yres_virtual * xres_virtual < 2^32 */
      }
      matroxfb_init_fix(PMINFO2);
      ACCESS_FBINFO(fbcon.screen_base) = vaddr_va(ACCESS_FBINFO(video.vbase));
      /* Normalize values (namely yres_virtual) */
      matroxfb_check_var(&vesafb_defined, &ACCESS_FBINFO(fbcon));
      /* And put it into "current" var. Do NOT program hardware yet, or we'll not take over
       * vgacon correctly. fbcon_startup will call fb_set_par for us, WITHOUT check_var,
       * and unfortunately it will do it BEFORE vgacon contents is saved, so it won't work
       * anyway. But we at least tried... */
      ACCESS_FBINFO(fbcon.var) = vesafb_defined;
      err = -EINVAL;

      printk(KERN_INFO "matroxfb: %dx%dx%dbpp (virtual: %dx%d)\n",
            vesafb_defined.xres, vesafb_defined.yres, vesafb_defined.bits_per_pixel,
            vesafb_defined.xres_virtual, vesafb_defined.yres_virtual);
      printk(KERN_INFO "matroxfb: framebuffer at 0x%lX, mapped to 0x%p, size %d\n",
            ACCESS_FBINFO(video.base), vaddr_va(ACCESS_FBINFO(video.vbase)), ACCESS_FBINFO(video.len));

/* We do not have to set currcon to 0... register_framebuffer do it for us on first console
 * and we do not want currcon == 0 for subsequent framebuffers */

      ACCESS_FBINFO(fbcon).device = &ACCESS_FBINFO(pcidev)->dev;
      if (register_framebuffer(&ACCESS_FBINFO(fbcon)) < 0) {
            goto failVideoIO;
      }
      printk("fb%d: %s frame buffer device\n",
             ACCESS_FBINFO(fbcon.node), ACCESS_FBINFO(fbcon.fix.id));

      /* there is no console on this fb... but we have to initialize hardware
       * until someone tells me what is proper thing to do */
      if (!ACCESS_FBINFO(initialized)) {
            printk(KERN_INFO "fb%d: initializing hardware\n",
                   ACCESS_FBINFO(fbcon.node));
            /* We have to use FB_ACTIVATE_FORCE, as we had to put vesafb_defined to the fbcon.var
             * already before, so register_framebuffer works correctly. */
            vesafb_defined.activate |= FB_ACTIVATE_FORCE;
            fb_set_var(&ACCESS_FBINFO(fbcon), &vesafb_defined);
      }

      return 0;
failVideoIO:;
      matroxfb_g450_shutdown(PMINFO2);
      mga_iounmap(ACCESS_FBINFO(video.vbase));
failCtrlIO:;
      mga_iounmap(ACCESS_FBINFO(mmio.vbase));
failVideoMR:;
      release_mem_region(video_base_phys, ACCESS_FBINFO(video.len_maximum));
failCtrlMR:;
      release_mem_region(ctrlptr_phys, 16384);
fail:;
      return err;
}

static LIST_HEAD(matroxfb_list);
static LIST_HEAD(matroxfb_driver_list);

#define matroxfb_l(x) list_entry(x, struct matrox_fb_info, next_fb)
#define matroxfb_driver_l(x) list_entry(x, struct matroxfb_driver, node)
int matroxfb_register_driver(struct matroxfb_driver* drv) {
      struct matrox_fb_info* minfo;

      list_add(&drv->node, &matroxfb_driver_list);
      for (minfo = matroxfb_l(matroxfb_list.next);
           minfo != matroxfb_l(&matroxfb_list);
           minfo = matroxfb_l(minfo->next_fb.next)) {
            void* p;

            if (minfo->drivers_count == MATROXFB_MAX_FB_DRIVERS)
                  continue;
            p = drv->probe(minfo);
            if (p) {
                  minfo->drivers_data[minfo->drivers_count] = p;
                  minfo->drivers[minfo->drivers_count++] = drv;
            }
      }
      return 0;
}

void matroxfb_unregister_driver(struct matroxfb_driver* drv) {
      struct matrox_fb_info* minfo;

      list_del(&drv->node);
      for (minfo = matroxfb_l(matroxfb_list.next);
           minfo != matroxfb_l(&matroxfb_list);
           minfo = matroxfb_l(minfo->next_fb.next)) {
            int i;

            for (i = 0; i < minfo->drivers_count; ) {
                  if (minfo->drivers[i] == drv) {
                        if (drv && drv->remove)
                              drv->remove(minfo, minfo->drivers_data[i]);
                        minfo->drivers[i] = minfo->drivers[--minfo->drivers_count];
                        minfo->drivers_data[i] = minfo->drivers_data[minfo->drivers_count];
                  } else
                        i++;
            }
      }
}

static void matroxfb_register_device(struct matrox_fb_info* minfo) {
      struct matroxfb_driver* drv;
      int i = 0;
      list_add(&ACCESS_FBINFO(next_fb), &matroxfb_list);
      for (drv = matroxfb_driver_l(matroxfb_driver_list.next);
           drv != matroxfb_driver_l(&matroxfb_driver_list);
           drv = matroxfb_driver_l(drv->node.next)) {
            if (drv && drv->probe) {
                  void *p = drv->probe(minfo);
                  if (p) {
                        minfo->drivers_data[i] = p;
                        minfo->drivers[i++] = drv;
                        if (i == MATROXFB_MAX_FB_DRIVERS)
                              break;
                  }
            }
      }
      minfo->drivers_count = i;
}

static void matroxfb_unregister_device(struct matrox_fb_info* minfo) {
      int i;

      list_del(&ACCESS_FBINFO(next_fb));
      for (i = 0; i < minfo->drivers_count; i++) {
            struct matroxfb_driver* drv = minfo->drivers[i];

            if (drv && drv->remove)
                  drv->remove(minfo, minfo->drivers_data[i]);
      }
}

static int matroxfb_probe(struct pci_dev* pdev, const struct pci_device_id* dummy) {
      struct board* b;
      u_int16_t svid;
      u_int16_t sid;
      struct matrox_fb_info* minfo;
      int err;
      u_int32_t cmd;
#ifndef CONFIG_FB_MATROX_MULTIHEAD
      static int registered = 0;
#endif
      DBG(__func__)

      svid = pdev->subsystem_vendor;
      sid = pdev->subsystem_device;
      for (b = dev_list; b->vendor; b++) {
            if ((b->vendor != pdev->vendor) || (b->device != pdev->device) || (b->rev < pdev->revision)) continue;
            if (b->svid)
                  if ((b->svid != svid) || (b->sid != sid)) continue;
            break;
      }
      /* not match... */
      if (!b->vendor)
            return -ENODEV;
      if (dev > 0) {
            /* not requested one... */
            dev--;
            return -ENODEV;
      }
      pci_read_config_dword(pdev, PCI_COMMAND, &cmd);
      if (pci_enable_device(pdev)) {
            return -1;
      }

#ifdef CONFIG_FB_MATROX_MULTIHEAD
      minfo = kmalloc(sizeof(*minfo), GFP_KERNEL);
      if (!minfo)
            return -1;
#else
      if (registered)   /* singlehead driver... */
            return -1;
      minfo = &matroxfb_global_mxinfo;
#endif
      memset(MINFO, 0, sizeof(*MINFO));

      ACCESS_FBINFO(pcidev) = pdev;
      ACCESS_FBINFO(dead) = 0;
      ACCESS_FBINFO(usecount) = 0;
      ACCESS_FBINFO(userusecount) = 0;

      pci_set_drvdata(pdev, MINFO);
      /* DEVFLAGS */
      ACCESS_FBINFO(devflags.memtype) = memtype;
      if (memtype != -1)
            noinit = 0;
      if (cmd & PCI_COMMAND_MEMORY) {
            ACCESS_FBINFO(devflags.novga) = novga;
            ACCESS_FBINFO(devflags.nobios) = nobios;
            ACCESS_FBINFO(devflags.noinit) = noinit;
            /* subsequent heads always needs initialization and must not enable BIOS */
            novga = 1;
            nobios = 1;
            noinit = 0;
      } else {
            ACCESS_FBINFO(devflags.novga) = 1;
            ACCESS_FBINFO(devflags.nobios) = 1;
            ACCESS_FBINFO(devflags.noinit) = 0;
      }

      ACCESS_FBINFO(devflags.nopciretry) = no_pci_retry;
      ACCESS_FBINFO(devflags.mga_24bpp_fix) = inv24;
      ACCESS_FBINFO(devflags.precise_width) = option_precise_width;
      ACCESS_FBINFO(devflags.sgram) = sgram;
      ACCESS_FBINFO(capable.cross4MB) = cross4MB;

      spin_lock_init(&ACCESS_FBINFO(lock.DAC));
      spin_lock_init(&ACCESS_FBINFO(lock.accel));
      init_rwsem(&ACCESS_FBINFO(crtc2.lock));
      init_rwsem(&ACCESS_FBINFO(altout.lock));
      mutex_init(&ACCESS_FBINFO(fbcon).mm_lock);
      ACCESS_FBINFO(irq_flags) = 0;
      init_waitqueue_head(&ACCESS_FBINFO(crtc1.vsync.wait));
      init_waitqueue_head(&ACCESS_FBINFO(crtc2.vsync.wait));
      ACCESS_FBINFO(crtc1.panpos) = -1;

      err = initMatrox2(PMINFO b);
      if (!err) {
#ifndef CONFIG_FB_MATROX_MULTIHEAD
            registered = 1;
#endif
            matroxfb_register_device(MINFO);
            return 0;
      }
#ifdef CONFIG_FB_MATROX_MULTIHEAD
      kfree(minfo);
#endif
      return -1;
}

static void pci_remove_matrox(struct pci_dev* pdev) {
      struct matrox_fb_info* minfo;

      minfo = pci_get_drvdata(pdev);
      matroxfb_remove(PMINFO 1);
}

static struct pci_device_id matroxfb_devices[] = {
#ifdef CONFIG_FB_MATROX_MILLENIUM
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_MIL,
            PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_MIL_2,
            PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_MIL_2_AGP,
            PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
#endif
#ifdef CONFIG_FB_MATROX_MYSTIQUE
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_MYS,
            PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
#endif
#ifdef CONFIG_FB_MATROX_G
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G100_MM,
            PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G100_AGP,
            PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G200EV_PCI,
            PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G200_PCI,
            PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G200_AGP,
            PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G400,
            PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
      {PCI_VENDOR_ID_MATROX,  PCI_DEVICE_ID_MATROX_G550,
            PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
#endif
      {0,               0,
            0,          0,          0, 0, 0}
};

MODULE_DEVICE_TABLE(pci, matroxfb_devices);


static struct pci_driver matroxfb_driver = {
      .name =           "matroxfb",
      .id_table = matroxfb_devices,
      .probe =    matroxfb_probe,
      .remove =   pci_remove_matrox,
};

/* **************************** init-time only **************************** */

#define RSResolution(X) ((X) & 0x0F)
#define RS640x400 1
#define RS640x480 2
#define RS800x600 3
#define RS1024x768      4
#define RS1280x1024     5
#define RS1600x1200     6
#define RS768x576 7
#define RS960x720 8
#define RS1152x864      9
#define RS1408x1056     10
#define RS640x350 11
#define RS1056x344      12    /* 132 x 43 text */
#define RS1056x400      13    /* 132 x 50 text */
#define RS1056x480      14    /* 132 x 60 text */
#define RSNoxNo         15
/* 10-FF */
static struct { int xres, yres, left, right, upper, lower, hslen, vslen, vfreq; } timmings[] __initdata = {
      {  640,  400,  48, 16, 39,  8,  96, 2, 70 },
      {  640,  480,  48, 16, 33, 10,  96, 2, 60 },
      {  800,  600, 144, 24, 28,  8, 112, 6, 60 },
      { 1024,  768, 160, 32, 30,  4, 128, 4, 60 },
      { 1280, 1024, 224, 32, 32,  4, 136, 4, 60 },
      { 1600, 1200, 272, 48, 32,  5, 152, 5, 60 },
      {  768,  576, 144, 16, 28,  6, 112, 4, 60 },
      {  960,  720, 144, 24, 28,  8, 112, 4, 60 },
      { 1152,  864, 192, 32, 30,  4, 128, 4, 60 },
      { 1408, 1056, 256, 40, 32,  5, 144, 5, 60 },
      {  640,  350,  48, 16, 39,  8,  96, 2, 70 },
      { 1056,  344,  96, 24, 59, 44, 160, 2, 70 },
      { 1056,  400,  96, 24, 39,  8, 160, 2, 70 },
      { 1056,  480,  96, 24, 36, 12, 160, 3, 60 },
      {    0,    0,  ~0, ~0, ~0, ~0,   0, 0,  0 }
};

#define RSCreate(X,Y)   ((X) | ((Y) << 8))
static struct { unsigned int vesa; unsigned int info; } *RSptr, vesamap[] __initdata = {
/* default must be first */
      {    ~0, RSCreate(RSNoxNo,     RS8bpp ) },
      { 0x101, RSCreate(RS640x480,   RS8bpp ) },
      { 0x100, RSCreate(RS640x400,   RS8bpp ) },
      { 0x180, RSCreate(RS768x576,   RS8bpp ) },
      { 0x103, RSCreate(RS800x600,   RS8bpp ) },
      { 0x188, RSCreate(RS960x720,   RS8bpp ) },
      { 0x105, RSCreate(RS1024x768,  RS8bpp ) },
      { 0x190, RSCreate(RS1152x864,  RS8bpp ) },
      { 0x107, RSCreate(RS1280x1024, RS8bpp ) },
      { 0x198, RSCreate(RS1408x1056, RS8bpp ) },
      { 0x11C, RSCreate(RS1600x1200, RS8bpp ) },
      { 0x110, RSCreate(RS640x480,   RS15bpp) },
      { 0x181, RSCreate(RS768x576,   RS15bpp) },
      { 0x113, RSCreate(RS800x600,   RS15bpp) },
      { 0x189, RSCreate(RS960x720,   RS15bpp) },
      { 0x116, RSCreate(RS1024x768,  RS15bpp) },
      { 0x191, RSCreate(RS1152x864,  RS15bpp) },
      { 0x119, RSCreate(RS1280x1024, RS15bpp) },
      { 0x199, RSCreate(RS1408x1056, RS15bpp) },
      { 0x11D, RSCreate(RS1600x1200, RS15bpp) },
      { 0x111, RSCreate(RS640x480,   RS16bpp) },
      { 0x182, RSCreate(RS768x576,   RS16bpp) },
      { 0x114, RSCreate(RS800x600,   RS16bpp) },
      { 0x18A, RSCreate(RS960x720,   RS16bpp) },
      { 0x117, RSCreate(RS1024x768,  RS16bpp) },
      { 0x192, RSCreate(RS1152x864,  RS16bpp) },
      { 0x11A, RSCreate(RS1280x1024, RS16bpp) },
      { 0x19A, RSCreate(RS1408x1056, RS16bpp) },
      { 0x11E, RSCreate(RS1600x1200, RS16bpp) },
      { 0x1B2, RSCreate(RS640x480,   RS24bpp) },
      { 0x184, RSCreate(RS768x576,   RS24bpp) },
      { 0x1B5, RSCreate(RS800x600,   RS24bpp) },
      { 0x18C, RSCreate(RS960x720,   RS24bpp) },
      { 0x1B8, RSCreate(RS1024x768,  RS24bpp) },
      { 0x194, RSCreate(RS1152x864,  RS24bpp) },
      { 0x1BB, RSCreate(RS1280x1024, RS24bpp) },
      { 0x19C, RSCreate(RS1408x1056, RS24bpp) },
      { 0x1BF, RSCreate(RS1600x1200, RS24bpp) },
      { 0x112, RSCreate(RS640x480,   RS32bpp) },
      { 0x183, RSCreate(RS768x576,   RS32bpp) },
      { 0x115, RSCreate(RS800x600,   RS32bpp) },
      { 0x18B, RSCreate(RS960x720,   RS32bpp) },
      { 0x118, RSCreate(RS1024x768,  RS32bpp) },
      { 0x193, RSCreate(RS1152x864,  RS32bpp) },
      { 0x11B, RSCreate(RS1280x1024, RS32bpp) },
      { 0x19B, RSCreate(RS1408x1056, RS32bpp) },
      { 0x11F, RSCreate(RS1600x1200, RS32bpp) },
      { 0x010, RSCreate(RS640x350,   RS4bpp ) },
      { 0x012, RSCreate(RS640x480,   RS4bpp ) },
      { 0x102, RSCreate(RS800x600,   RS4bpp ) },
      { 0x104, RSCreate(RS1024x768,  RS4bpp ) },
      { 0x106, RSCreate(RS1280x1024, RS4bpp ) },
      {     0, 0                    }};

static void __init matroxfb_init_params(void) {
      /* fh from kHz to Hz */
      if (fh < 1000)
            fh *= 1000; /* 1kHz minimum */
      /* maxclk */
      if (maxclk < 1000) maxclk *= 1000;  /* kHz -> Hz, MHz -> kHz */
      if (maxclk < 1000000) maxclk *= 1000;     /* kHz -> Hz, 1MHz minimum */
      /* fix VESA number */
      if (vesa != ~0)
            vesa &= 0x1DFF;         /* mask out clearscreen, acceleration and so on */

      /* static settings */
      for (RSptr = vesamap; RSptr->vesa; RSptr++) {
            if (RSptr->vesa == vesa) break;
      }
      if (!RSptr->vesa) {
            printk(KERN_ERR "Invalid vesa mode 0x%04X\n", vesa);
            RSptr = vesamap;
      }
      {
            int res = RSResolution(RSptr->info)-1;
            if (left == ~0)
                  left = timmings[res].left;
            if (!xres)
                  xres = timmings[res].xres;
            if (right == ~0)
                  right = timmings[res].right;
            if (!hslen)
                  hslen = timmings[res].hslen;
            if (upper == ~0)
                  upper = timmings[res].upper;
            if (!yres)
                  yres = timmings[res].yres;
            if (lower == ~0)
                  lower = timmings[res].lower;
            if (!vslen)
                  vslen = timmings[res].vslen;
            if (!(fv||fh||maxclk||pixclock))
                  fv = timmings[res].vfreq;
            if (depth == -1)
                  depth = RSDepth(RSptr->info);
      }
}

static int __init matrox_init(void) {
      int err;

      matroxfb_init_params();
      err = pci_register_driver(&matroxfb_driver);
      dev = -1;   /* accept all new devices... */
      return err;
}

/* **************************** exit-time only **************************** */

static void __exit matrox_done(void) {
      pci_unregister_driver(&matroxfb_driver);
}

#ifndef MODULE

/* ************************* init in-kernel code ************************** */

static int __init matroxfb_setup(char *options) {
      char *this_opt;

      DBG(__func__)

      if (!options || !*options)
            return 0;

      while ((this_opt = strsep(&options, ",")) != NULL) {
            if (!*this_opt) continue;

            dprintk("matroxfb_setup: option %s\n", this_opt);

            if (!strncmp(this_opt, "dev:", 4))
                  dev = simple_strtoul(this_opt+4, NULL, 0);
            else if (!strncmp(this_opt, "depth:", 6)) {
                  switch (simple_strtoul(this_opt+6, NULL, 0)) {
                        case 0: depth = RSText; break;
                        case 4: depth = RS4bpp; break;
                        case 8: depth = RS8bpp; break;
                        case 15:depth = RS15bpp; break;
                        case 16:depth = RS16bpp; break;
                        case 24:depth = RS24bpp; break;
                        case 32:depth = RS32bpp; break;
                        default:
                              printk(KERN_ERR "matroxfb: unsupported color depth\n");
                  }
            } else if (!strncmp(this_opt, "xres:", 5))
                  xres = simple_strtoul(this_opt+5, NULL, 0);
            else if (!strncmp(this_opt, "yres:", 5))
                  yres = simple_strtoul(this_opt+5, NULL, 0);
            else if (!strncmp(this_opt, "vslen:", 6))
                  vslen = simple_strtoul(this_opt+6, NULL, 0);
            else if (!strncmp(this_opt, "hslen:", 6))
                  hslen = simple_strtoul(this_opt+6, NULL, 0);
            else if (!strncmp(this_opt, "left:", 5))
                  left = simple_strtoul(this_opt+5, NULL, 0);
            else if (!strncmp(this_opt, "right:", 6))
                  right = simple_strtoul(this_opt+6, NULL, 0);
            else if (!strncmp(this_opt, "upper:", 6))
                  upper = simple_strtoul(this_opt+6, NULL, 0);
            else if (!strncmp(this_opt, "lower:", 6))
                  lower = simple_strtoul(this_opt+6, NULL, 0);
            else if (!strncmp(this_opt, "pixclock:", 9))
                  pixclock = simple_strtoul(this_opt+9, NULL, 0);
            else if (!strncmp(this_opt, "sync:", 5))
                  sync = simple_strtoul(this_opt+5, NULL, 0);
            else if (!strncmp(this_opt, "vesa:", 5))
                  vesa = simple_strtoul(this_opt+5, NULL, 0);
            else if (!strncmp(this_opt, "maxclk:", 7))
                  maxclk = simple_strtoul(this_opt+7, NULL, 0);
            else if (!strncmp(this_opt, "fh:", 3))
                  fh = simple_strtoul(this_opt+3, NULL, 0);
            else if (!strncmp(this_opt, "fv:", 3))
                  fv = simple_strtoul(this_opt+3, NULL, 0);
            else if (!strncmp(this_opt, "mem:", 4))
                  mem = simple_strtoul(this_opt+4, NULL, 0);
            else if (!strncmp(this_opt, "mode:", 5))
                  strlcpy(videomode, this_opt+5, sizeof(videomode));
            else if (!strncmp(this_opt, "outputs:", 8))
                  strlcpy(outputs, this_opt+8, sizeof(outputs));
            else if (!strncmp(this_opt, "dfp:", 4)) {
                  dfp_type = simple_strtoul(this_opt+4, NULL, 0);
                  dfp = 1;
            }
#ifdef CONFIG_PPC_PMAC
            else if (!strncmp(this_opt, "vmode:", 6)) {
                  unsigned int vmode = simple_strtoul(this_opt+6, NULL, 0);
                  if (vmode > 0 && vmode <= VMODE_MAX)
                        default_vmode = vmode;
            } else if (!strncmp(this_opt, "cmode:", 6)) {
                  unsigned int cmode = simple_strtoul(this_opt+6, NULL, 0);
                  switch (cmode) {
                        case 0:
                        case 8:
                              default_cmode = CMODE_8;
                              break;
                        case 15:
                        case 16:
                              default_cmode = CMODE_16;
                              break;
                        case 24:
                        case 32:
                              default_cmode = CMODE_32;
                              break;
                  }
            }
#endif
            else if (!strcmp(this_opt, "disabled"))   /* nodisabled does not exist */
                  disabled = 1;
            else if (!strcmp(this_opt, "enabled"))    /* noenabled does not exist */
                  disabled = 0;
            else if (!strcmp(this_opt, "sgram"))      /* nosgram == sdram */
                  sgram = 1;
            else if (!strcmp(this_opt, "sdram"))
                  sgram = 0;
            else if (!strncmp(this_opt, "memtype:", 8))
                  memtype = simple_strtoul(this_opt+8, NULL, 0);
            else {
                  int value = 1;

                  if (!strncmp(this_opt, "no", 2)) {
                        value = 0;
                        this_opt += 2;
                  }
                  if (! strcmp(this_opt, "inverse"))
                        inverse = value;
                  else if (!strcmp(this_opt, "accel"))
                        noaccel = !value;
                  else if (!strcmp(this_opt, "pan"))
                        nopan = !value;
                  else if (!strcmp(this_opt, "pciretry"))
                        no_pci_retry = !value;
                  else if (!strcmp(this_opt, "vga"))
                        novga = !value;
                  else if (!strcmp(this_opt, "bios"))
                        nobios = !value;
                  else if (!strcmp(this_opt, "init"))
                        noinit = !value;
#ifdef CONFIG_MTRR
                  else if (!strcmp(this_opt, "mtrr"))
                        mtrr = value;
#endif
                  else if (!strcmp(this_opt, "inv24"))
                        inv24 = value;
                  else if (!strcmp(this_opt, "cross4MB"))
                        cross4MB = value;
                  else if (!strcmp(this_opt, "grayscale"))
                        grayscale = value;
                  else if (!strcmp(this_opt, "dfp"))
                        dfp = value;
                  else {
                        strlcpy(videomode, this_opt, sizeof(videomode));
                  }
            }
      }
      return 0;
}

static int __initdata initialized = 0;

static int __init matroxfb_init(void)
{
      char *option = NULL;
      int err = 0;

      DBG(__func__)

      if (fb_get_options("matroxfb", &option))
            return -ENODEV;
      matroxfb_setup(option);

      if (disabled)
            return -ENXIO;
      if (!initialized) {
            initialized = 1;
            err = matrox_init();
      }
      hotplug = 1;
      /* never return failure, user can hotplug matrox later... */
      return err;
}

module_init(matroxfb_init);

#else

/* *************************** init module code **************************** */

MODULE_AUTHOR("(c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
MODULE_DESCRIPTION("Accelerated FBDev driver for Matrox Millennium/Mystique/G100/G200/G400/G450/G550");
MODULE_LICENSE("GPL");

module_param(mem, int, 0);
MODULE_PARM_DESC(mem, "Size of available memory in MB, KB or B (2,4,8,12,16MB, default=autodetect)");
module_param(disabled, int, 0);
MODULE_PARM_DESC(disabled, "Disabled (0 or 1=disabled) (default=0)");
module_param(noaccel, int, 0);
MODULE_PARM_DESC(noaccel, "Do not use accelerating engine (0 or 1=disabled) (default=0)");
module_param(nopan, int, 0);
MODULE_PARM_DESC(nopan, "Disable pan on startup (0 or 1=disabled) (default=0)");
module_param(no_pci_retry, int, 0);
MODULE_PARM_DESC(no_pci_retry, "PCI retries enabled (0 or 1=disabled) (default=0)");
module_param(novga, int, 0);
MODULE_PARM_DESC(novga, "VGA I/O (0x3C0-0x3DF) disabled (0 or 1=disabled) (default=0)");
module_param(nobios, int, 0);
MODULE_PARM_DESC(nobios, "Disables ROM BIOS (0 or 1=disabled) (default=do not change BIOS state)");
module_param(noinit, int, 0);
MODULE_PARM_DESC(noinit, "Disables W/SG/SD-RAM and bus interface initialization (0 or 1=do not initialize) (default=0)");
module_param(memtype, int, 0);
MODULE_PARM_DESC(memtype, "Memory type for G200/G400 (see Documentation/fb/matroxfb.txt for explanation) (default=3 for G200, 0 for G400)");
#ifdef CONFIG_MTRR
module_param(mtrr, int, 0);
MODULE_PARM_DESC(mtrr, "This speeds up video memory accesses (0=disabled or 1) (default=1)");
#endif
module_param(sgram, int, 0);
MODULE_PARM_DESC(sgram, "Indicates that G100/G200/G400 has SGRAM memory (0=SDRAM, 1=SGRAM) (default=0)");
module_param(inv24, int, 0);
MODULE_PARM_DESC(inv24, "Inverts clock polarity for 24bpp and loop frequency > 100MHz (default=do not invert polarity)");
module_param(inverse, int, 0);
MODULE_PARM_DESC(inverse, "Inverse (0 or 1) (default=0)");
#ifdef CONFIG_FB_MATROX_MULTIHEAD
module_param(dev, int, 0);
MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=all working)");
#else
module_param(dev, int, 0);
MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=first working)");
#endif
module_param(vesa, int, 0);
MODULE_PARM_DESC(vesa, "Startup videomode (0x000-0x1FF) (default=0x101)");
module_param(xres, int, 0);
MODULE_PARM_DESC(xres, "Horizontal resolution (px), overrides xres from vesa (default=vesa)");
module_param(yres, int, 0);
MODULE_PARM_DESC(yres, "Vertical resolution (scans), overrides yres from vesa (default=vesa)");
module_param(upper, int, 0);
MODULE_PARM_DESC(upper, "Upper blank space (scans), overrides upper from vesa (default=vesa)");
module_param(lower, int, 0);
MODULE_PARM_DESC(lower, "Lower blank space (scans), overrides lower from vesa (default=vesa)");
module_param(vslen, int, 0);
MODULE_PARM_DESC(vslen, "Vertical sync length (scans), overrides lower from vesa (default=vesa)");
module_param(left, int, 0);
MODULE_PARM_DESC(left, "Left blank space (px), overrides left from vesa (default=vesa)");
module_param(right, int, 0);
MODULE_PARM_DESC(right, "Right blank space (px), overrides right from vesa (default=vesa)");
module_param(hslen, int, 0);
MODULE_PARM_DESC(hslen, "Horizontal sync length (px), overrides hslen from vesa (default=vesa)");
module_param(pixclock, int, 0);
MODULE_PARM_DESC(pixclock, "Pixelclock (ns), overrides pixclock from vesa (default=vesa)");
module_param(sync, int, 0);
MODULE_PARM_DESC(sync, "Sync polarity, overrides sync from vesa (default=vesa)");
module_param(depth, int, 0);
MODULE_PARM_DESC(depth, "Color depth (0=text,8,15,16,24,32) (default=vesa)");
module_param(maxclk, int, 0);
MODULE_PARM_DESC(maxclk, "Startup maximal clock, 0-999MHz, 1000-999999kHz, 1000000-INF Hz");
module_param(fh, int, 0);
MODULE_PARM_DESC(fh, "Startup horizontal frequency, 0-999kHz, 1000-INF Hz");
module_param(fv, int, 0);
MODULE_PARM_DESC(fv, "Startup vertical frequency, 0-INF Hz\n"
"You should specify \"fv:max_monitor_vsync,fh:max_monitor_hsync,maxclk:max_monitor_dotclock\"");
module_param(grayscale, int, 0);
MODULE_PARM_DESC(grayscale, "Sets display into grayscale. Works perfectly with paletized videomode (4, 8bpp), some limitations apply to 16, 24 and 32bpp videomodes (default=nograyscale)");
module_param(cross4MB, int, 0);
MODULE_PARM_DESC(cross4MB, "Specifies that 4MB boundary can be in middle of line. (default=autodetected)");
module_param(dfp, int, 0);
MODULE_PARM_DESC(dfp, "Specifies whether to use digital flat panel interface of G200/G400 (0 or 1) (default=0)");
module_param(dfp_type, int, 0);
MODULE_PARM_DESC(dfp_type, "Specifies DFP interface type (0 to 255) (default=read from hardware)");
module_param_string(outputs, outputs, sizeof(outputs), 0);
MODULE_PARM_DESC(outputs, "Specifies which CRTC is mapped to which output (string of up to three letters, consisting of 0 (disabled), 1 (CRTC1), 2 (CRTC2)) (default=111 for Gx50, 101 for G200/G400 with DFP, and 100 for all other devices)");
#ifdef CONFIG_PPC_PMAC
module_param_named(vmode, default_vmode, int, 0);
MODULE_PARM_DESC(vmode, "Specify the vmode mode number that should be used (640x480 default)");
module_param_named(cmode, default_cmode, int, 0);
MODULE_PARM_DESC(cmode, "Specify the video depth that should be used (8bit default)");
#endif

int __init init_module(void){

      DBG(__func__)

      if (disabled)
            return -ENXIO;

      if (depth == 0)
            depth = RSText;
      else if (depth == 4)
            depth = RS4bpp;
      else if (depth == 8)
            depth = RS8bpp;
      else if (depth == 15)
            depth = RS15bpp;
      else if (depth == 16)
            depth = RS16bpp;
      else if (depth == 24)
            depth = RS24bpp;
      else if (depth == 32)
            depth = RS32bpp;
      else if (depth != -1) {
            printk(KERN_ERR "matroxfb: depth %d is not supported, using default\n", depth);
            depth = -1;
      }
      matrox_init();
      /* never return failure; user can hotplug matrox later... */
      return 0;
}
#endif      /* MODULE */

module_exit(matrox_done);
EXPORT_SYMBOL(matroxfb_register_driver);
EXPORT_SYMBOL(matroxfb_unregister_driver);
EXPORT_SYMBOL(matroxfb_wait_for_sync);
EXPORT_SYMBOL(matroxfb_enable_irq);

/*
 * Overrides for Emacs so that we follow Linus's tabbing style.
 * ---------------------------------------------------------------------------
 * Local variables:
 * c-basic-offset: 8
 * End:
 */


Generated by  Doxygen 1.6.0   Back to index